missing translation for 'onlineSavingsMsg'
Learn More
Learn More
Potassium Dichromate, 0.100 N (N/10), 0.0167 M (M/60), Ricca Chemical
Supplier: Ricca Chemical Company 606032
Specifications
| Potassium Dichromate | |
| 7778-50-9,7732-18-5 | |
| 100.0,0.5 | |
| potassium dichromate, potassium bichromate, kaliumdichromat, iopezite, dipotassium bichromate, dipotassium dichromate, potassium dichromate vi, dichromic acid dipotassium salt, dipotassium dichromium heptaoxide, bichromate of potash | |
| [O-][Cr](=O)(=O)O[Cr](=O)(=O)[O-].[K+].[K+] | |
| 294.182 | |
| CHEBI:53444 | |
| Natural Poly Bottle | |
| ∼4 | |
| Liquid |
| Orange | |
| 98.0,0.48 | |
| Cr2K2O7 | |
| KMUONIBRACKNSN-UHFFFAOYSA-N | |
| dipotassium;oxido-(oxido(dioxo)chromio)oxy-dioxochromium | |
| 24502 | |
| Laboratory | |
| ACS/EP/USP Volumetric Solution | |
| 1 L | |
| 0.100N,0.0167M |
Chemical Identifiers
| 7778-50-9 | |
| 294.182 | |
| potassium dichromate, potassium bichromate, kaliumdichromat, iopezite, dipotassium bichromate, dipotassium dichromate, potassium dichromate vi, dichromic acid dipotassium salt, dipotassium dichromium heptaoxide, bichromate of potash | |
| CHEBI:53444 | |
| [O-][Cr](=O)(=O)O[Cr](=O)(=O)[O-].[K+].[K+] |
| Cr2K2O7 | |
| KMUONIBRACKNSN-UHFFFAOYSA-N | |
| 24502 | |
| dipotassium;oxido-(oxido(dioxo)chromio)oxy-dioxochromium |