missing translation for 'onlineSavingsMsg'
Learn More
Learn More
Pleconaril, Thermo Scientific™
Supplier: Thermo Scientific Chemicals 469221000
Specifications
| Pleconaril | |
| 100 mg | |
| C18 H18 F3 N3 O3 | |
| MFCD00923611 | |
| White to Beige | |
| KQOXLKOJHVFTRN-UHFFFAOYSA-N | |
| 3-{3,5-dimethyl-4-[3-(3-methyl-1,2-oxazol-5-yl)propoxy]phenyl}-5-(trifluoromethyl)-1,2,4-oxadiazole |
| 153168-05-9 | |
| 55°C to 65°C | |
| 381.35 | |
| Powder | |
| ≥97.5% | |
| CC1=NOC(CCCOC2=C(C)C=C(C=C2C)C2=NOC(=N2)C(F)(F)F)=C1 | |
| 381.36 |
Chemical Identifiers
| 153168-05-9 | |
| 381.36 | |
| KQOXLKOJHVFTRN-UHFFFAOYSA-N | |
| CC1=NOC(CCCOC2=C(C)C=C(C=C2C)C2=NOC(=N2)C(F)(F)F)=C1 |
| C18 H18 F3 N3 O3 | |
| MFCD00923611 | |
| 3-{3,5-dimethyl-4-[3-(3-methyl-1,2-oxazol-5-yl)propoxy]phenyl}-5-(trifluoromethyl)-1,2,4-oxadiazole |
Safety and Handling
Skull and crossbones
Recommended Storage : Normal conditions