Learn More
Phthalamic acid, 99%
CAS: 88-97-1 | C8H7NO3 | 165.148 g/mol
$82.62 - $298.34
Chemical Identifiers
| CAS | 88-97-1 |
|---|---|
| Molecular Formula | C8H7NO3 |
| Molecular Weight (g/mol) | 165.148 |
| MDL Number | MFCD00025476 |
| InChI Key | CYMRPDYINXWJFU-UHFFFAOYSA-N |
| Synonym | phthalamic acid, phthalamidic acid, phthalamide acid, phthalic monoamide, phthalic acid monoamide, o-carbamoylbenzoic acid, benzoic acid, 2-aminocarbonyl, benzoic acid, o-carbamoyl, unii-v344h4pf3y, 2-aminocarbonyl benzoic acid |
| PubChem CID | 6957 |
| ChEBI | CHEBI:50736 |
| IUPAC Name | 2-carbamoylbenzoic acid |
| SMILES | C1=CC=C(C(=C1)C(=O)N)C(=O)O |
| Catalog Number | Mfr. No. | Quantity | Price | Quantity | |||||
|---|---|---|---|---|---|---|---|---|---|
| Catalog Number | Mfr. No. | Quantity | Price | Quantity | |||||
|
AAL1243206
|
Thermo Scientific Chemicals
L1243206 |
5 g |
Each for $82.62
|
|
|||||
|
AAL1243214
|
Thermo Scientific Chemicals
L1243214 |
25 g |
Each for $298.34
|
|
|||||
Description
This Thermo Scientific Chemicals brand product was originally part of the Alfa Aesar product portfolio. Some documentation and label information may refer to the legacy brand. The original Alfa Aesar product / item code or SKU reference has not changed as a part of the brand transition to Thermo Scientific Chemicals.
Chemical Identifiers
| 88-97-1 | |
| 165.148 | |
| CYMRPDYINXWJFU-UHFFFAOYSA-N | |
| 6957 | |
| 2-carbamoylbenzoic acid |
| C8H7NO3 | |
| MFCD00025476 | |
| phthalamic acid, phthalamidic acid, phthalamide acid, phthalic monoamide, phthalic acid monoamide, o-carbamoylbenzoic acid, benzoic acid, 2-aminocarbonyl, benzoic acid, o-carbamoyl, unii-v344h4pf3y, 2-aminocarbonyl benzoic acid | |
| CHEBI:50736 | |
| C1=CC=C(C(=C1)C(=O)N)C(=O)O |
Specifications
| 88-97-1 | |
| C8H7NO3 | |
| 5 g | |
| phthalamic acid, phthalamidic acid, phthalamide acid, phthalic monoamide, phthalic acid monoamide, o-carbamoylbenzoic acid, benzoic acid, 2-aminocarbonyl, benzoic acid, o-carbamoyl, unii-v344h4pf3y, 2-aminocarbonyl benzoic acid | |
| C1=CC=C(C(=C1)C(=O)N)C(=O)O | |
| 165.148 | |
| CHEBI:50736 | |
| 99% |
| 140°C to 143°C | |
| MFCD00025476 | |
| 1868205 | |
| CYMRPDYINXWJFU-UHFFFAOYSA-N | |
| 2-carbamoylbenzoic acid | |
| 6957 | |
| 165.15 | |
| Phthalamic acid |
Safety and Handling
GHS H Statement
H315-H319-H335
Causes skin irritation.
Causes serious eye irritation.
May cause respiratory irritation.
P261-P264b-P271-P280-P302+P352-P304+P340-P305+P351+P338-P312-P332+P313-P362-P501c
H315-H319-H335
EINECSNumber : 201-871-1
TSCA : Yes
Recommended Storage : Ambient temperatures
RUO – Research Use Only