missing translation for 'onlineSavingsMsg'
Learn More
Learn More
p-Toluenesulfonic Acid Monohydrate, Reagents
p-Toluenesulfonic Acid Monohydrate, ACS, for general laboratory use. Manufactured in ISO 9001 facility.
Supplier: Labchem Inc C1341050500A5
Alert:
This chemical may require us to obtain additional information for our regulatory and chemical compliance records. If required, we will contact you for this information once your order is placed.
Specifications
| p-Toluenesulfonic Acid Monohydrate | |
| 6192-52-5 | |
| White | |
| KJIFKLIQANRMOU-UHFFFAOYSA-N | |
| 4-methylbenzene-1-sulfonic acid hydrate | |
| ACS | |
| Poly Bottle | |
| 1.24 |
| 106°C | |
| 140°C | |
| C7H10O4S | |
| O.CC1=CC=C(C=C1)S(O)(=O)=O | |
| 190.21 | |
| 500 g | |
| Solid |
Chemical Identifiers
| 6192-52-5 | |
| 190.21 | |
| 4-methylbenzene-1-sulfonic acid hydrate |
| C7H10O4S | |
| KJIFKLIQANRMOU-UHFFFAOYSA-N | |
| O.CC1=CC=C(C=C1)S(O)(=O)=O |