Learn More
o-Tolidine, 95%, pract
CAS: 119-93-7 | C14H16N2 | 212.29 g/mol
Supplier: Thermo Scientific Chemicals 421121000
Description
This Thermo Scientific Chemicals brand product was originally part of the Acros Organics product portfolio. Some documentation and label information may refer to the legacy brand. The original Acros Organics product / item code or SKU reference has not changed as a part of the brand transition to Thermo Scientific Chemicals.
IndicatorSpecifications
| o-Tolidine | |
| 119-93-7 | |
| Beige or Brown to Gray | |
| 244°C | |
| 95% | |
| C14H16N2 | |
| 100 g | |
| 15, 9674 | |
| NUIURNJTPRWVAP-UHFFFAOYSA-N | |
| 4-(4-amino-3-methylphenyl)-2-methylaniline | |
| 8413 | |
| 212.29 | |
| Powder |
| (pract), 95% | |
| 125.0°C to 132.0°C | |
| 300.5°C | |
| Authentic | |
| Glass bottle | |
| MFCD00014773 | |
| 13, IV, 419 | |
| o-tolidine, 3,3'-dimethylbenzidine, orthotolidine, diaminoditolyl, 2-tolidine, diaminotolyl, bianisidine, 3,3'-tolidine, 3,3'-dimethylbiphenyl-4,4'-diamine, 4,4'-bi-o-toluidine | |
| CC1=C(C=CC(=C1)C2=CC(=C(C=C2)N)C)N | |
| 212.29 | |
| CHEBI:34320 | |
| 95% |
Chemical Identifiers
| 119-93-7 | |
| NUIURNJTPRWVAP-UHFFFAOYSA-N | |
| 8413 | |
| 4-(4-amino-3-methylphenyl)-2-methylaniline |
| MFCD00014773 | |
| o-tolidine, 3,3'-dimethylbenzidine, orthotolidine, diaminoditolyl, 2-tolidine, diaminotolyl, bianisidine, 3,3'-tolidine, 3,3'-dimethylbiphenyl-4,4'-diamine, 4,4'-bi-o-toluidine | |
| CHEBI:34320 | |
| CC1=C(C=CC(=C1)C2=CC(=C(C=C2)N)C)N |
Safety and Handling
GHS H Statement
May cause cancer.
Toxic to aquatic life with long lasting effects.
Harmful if swallowed.
GHS P Statement
Obtain special instructions before use.
IF exposed or concerned: Get medical advice/attention.
IF SWALLOWED: Call a POISON CENTER or doctor/physician if you feel unwell.
Avoid release to the environment.
GHS Signal Word: Danger
EINECSNumber : 204-358-0
RTECSNumber : DD1225000
TSCA : TSCA
RUO – Research Use Only