Learn More
o-Tolidine, 95%, pract
CAS: 119-93-7 | C14H16N2 | 212.29 g/mol
$112.64 - $479.48
Chemical Identifiers
| CAS | 119-93-7 |
|---|---|
| MDL Number | MFCD00014773 |
| InChI Key | NUIURNJTPRWVAP-UHFFFAOYSA-N |
| Synonym | o-tolidine, 3,3'-dimethylbenzidine, orthotolidine, diaminoditolyl, 2-tolidine, diaminotolyl, bianisidine, 3,3'-tolidine, 3,3'-dimethylbiphenyl-4,4'-diamine, 4,4'-bi-o-toluidine |
| PubChem CID | 8413 |
| ChEBI | CHEBI:34320 |
| IUPAC Name | 4-(4-amino-3-methylphenyl)-2-methylaniline |
| SMILES | CC1=C(C=CC(=C1)C2=CC(=C(C=C2)N)C)N |
| Catalog Number | Mfr. No. | Quantity | Price | Quantity | |||||
|---|---|---|---|---|---|---|---|---|---|
| Catalog Number | Mfr. No. | Quantity | Price | Quantity | |||||
|
AC421120250
|
Thermo Scientific Chemicals
421120250 |
25 g |
Each for $112.64
|
|
|||||
|
AC421121000
|
Thermo Scientific Chemicals
421121000 |
100 g |
Each for $261.29
|
|
|||||
|
AC421122500
|
Thermo Scientific Chemicals
421122500 |
250 g |
Each for $479.48
|
|
|||||
Description
This Thermo Scientific Chemicals brand product was originally part of the Acros Organics product portfolio. Some documentation and label information may refer to the legacy brand. The original Acros Organics product / item code or SKU reference has not changed as a part of the brand transition to Thermo Scientific Chemicals.
IndicatorChemical Identifiers
| 119-93-7 | |
| NUIURNJTPRWVAP-UHFFFAOYSA-N | |
| 8413 | |
| 4-(4-amino-3-methylphenyl)-2-methylaniline |
| MFCD00014773 | |
| o-tolidine, 3,3'-dimethylbenzidine, orthotolidine, diaminoditolyl, 2-tolidine, diaminotolyl, bianisidine, 3,3'-tolidine, 3,3'-dimethylbiphenyl-4,4'-diamine, 4,4'-bi-o-toluidine | |
| CHEBI:34320 | |
| CC1=C(C=CC(=C1)C2=CC(=C(C=C2)N)C)N |
Specifications
| 119-93-7 | |
| Beige or Brown to Gray | |
| 244°C | |
| 95% | |
| C14H16N2 | |
| 25 g | |
| 15, 9674 | |
| NUIURNJTPRWVAP-UHFFFAOYSA-N | |
| 4-(4-amino-3-methylphenyl)-2-methylaniline | |
| 8413 | |
| 212.29 | |
| Powder |
| 125.0°C to 132.0°C | |
| 300.5°C | |
| Authentic | |
| Glass bottle | |
| MFCD00014773 | |
| 13, IV, 419 | |
| o-tolidine, 3,3'-dimethylbenzidine, orthotolidine, diaminoditolyl, 2-tolidine, diaminotolyl, bianisidine, 3,3'-tolidine, 3,3'-dimethylbiphenyl-4,4'-diamine, 4,4'-bi-o-toluidine | |
| CC1=C(C=CC(=C1)C2=CC(=C(C=C2)N)C)N | |
| 212.29 | |
| CHEBI:34320 | |
| 95% | |
| o-Tolidine, (pract), 95% |
Safety and Handling
GHS H Statement
May cause cancer.
Toxic to aquatic life with long lasting effects.
Harmful if swallowed.
GHS P Statement
Obtain special instructions before use.
IF exposed or concerned: Get medical advice/attention.
IF SWALLOWED: Call a POISON CENTER or doctor/physician if you feel unwell.
Avoid release to the environment.
GHS Signal Word: Danger
EINECSNumber : 204-358-0
RTECSNumber : DD1225000
TSCA : TSCA
RUO – Research Use Only