missing translation for 'onlineSavingsMsg'
Learn More
Learn More
Thermo Scientific Chemicals o-Cresolphthalein Complexone, pure
CAS: 2411-89-4 | C32H32N2O12 | 636.61 g/mol
$137.48 - $418.49
Chemical Identifiers
| CAS | 2411-89-4 |
|---|---|
| Molecular Formula | C32H32N2O12 |
| Molecular Weight (g/mol) | 636.61 |
| MDL Number | MFCD00005911 |
| InChI Key | IYZPEGVSBUNMBE-UHFFFAOYSA-N |
| Synonym | o-Cresolphthalexon, Phthalein Complexon |
| PubChem CID | 75485 |
| IUPAC Name | 2-[({5-[1-(3-{[bis(carboxymethyl)amino]methyl}-4-hydroxy-5-methylphenyl)-3-oxo-1,3-dihydro-2-benzofuran-1-yl]-2-hydroxy-3-methylphenyl}methyl)(carboxymethyl)amino]acetic acid |
| SMILES | CC1=CC(=CC(CN(CC(O)=O)CC(O)=O)=C1O)C1(OC(=O)C2=CC=CC=C12)C1=CC(C)=C(O)C(CN(CC(O)=O)CC(O)=O)=C1 |
| Catalog Number | Mfr. No. | Quantity | Packaging | Price | Quantity | ||||
|---|---|---|---|---|---|---|---|---|---|
| Catalog Number | Mfr. No. | Quantity | Packaging | Price | Quantity | ||||
|
AC182440050
|
Thermo Scientific Chemicals
182440050 |
5 g | Glass bottle |
Each for $137.48
|
|
||||
|
AC182440250
|
Thermo Scientific Chemicals
182440250 |
25 g | Glass bottle |
Each for $418.49
|
|
||||
Description
This Thermo Scientific Chemicals brand product was originally part of the Acros Organics product portfolio. Some documentation and label information may refer to the legacy brand. The original Acros Organics product / item code or SKU reference has not changed as a part of the brand transition to Thermo Scientific Chemicals.
IndicatorChemical Identifiers
| 2411-89-4 | |
| 636.61 | |
| IYZPEGVSBUNMBE-UHFFFAOYSA-N | |
| 75485 | |
| CC1=CC(=CC(CN(CC(O)=O)CC(O)=O)=C1O)C1(OC(=O)C2=CC=CC=C12)C1=CC(C)=C(O)C(CN(CC(O)=O)CC(O)=O)=C1 |
| C32H32N2O12 | |
| MFCD00005911 | |
| o-Cresolphthalexon, Phthalein Complexon | |
| 2-[({5-[1-(3-{[bis(carboxymethyl)amino]methyl}-4-hydroxy-5-methylphenyl)-3-oxo-1,3-dihydro-2-benzofuran-1-yl]-2-hydroxy-3-methylphenyl}methyl)(carboxymethyl)amino]acetic acid |
Specifications
| 181.0°C | |
| C32H32N2O12 | |
| 15, 2566 | |
| Solubility in water: slightly soluble. Other solubilities: readily soluble in aqueous ammonia, readily soluble in organic solvents | |
| Authentic | |
| 2-[({5-[1-(3-{[bis(carboxymethyl)amino]methyl}-4-hydroxy-5-methylphenyl)-3-oxo-1,3-dihydro-2-benzofuran-1-yl]-2-hydroxy-3-methylphenyl}methyl)(carboxymethyl)amino]acetic acid | |
| 75485 | |
| 10% max. (1 g, 105°C) | |
| Pure | |
| As indicator for complexometry: Passes Test | |
| Brown to White | |
| Powder |
| 2411-89-4 | |
| MFCD00005911 | |
| o-Cresolphthalexon, Phthalein Complexon | |
| IYZPEGVSBUNMBE-UHFFFAOYSA-N | |
| CC1=CC(=CC(CN(CC(O)=O)CC(O)=O)=C1O)C1(OC(=O)C2=CC=CC=C12)C1=CC(C)=C(O)C(CN(CC(O)=O)CC(O)=O)=C1 | |
| 636.61 | |
| 573 to 579nm (in 0.1N NaOH) | |
| 636.6 | |
| Glass bottle | |
| Complies | |
| 5 g | |
| o-Cresolphthalein Complexone, Pure |
Safety and Handling
EINECSNumber : 219-318-8
TSCA : TSCA
RUO – Research Use Only