Learn More
Nocodazole, 98%
CAS: 31430-18-9 | C14H11N3O3S | 301.32 g/mol
$190.81 - $190.81
Chemical Identifiers
| CAS | 31430-18-9 |
|---|---|
| Molecular Formula | C14H11N3O3S |
| Molecular Weight (g/mol) | 301.32 |
| MDL Number | MFCD00005588 |
| InChI Key | KYRVNWMVYQXFEU-UHFFFAOYSA-N |
| Synonym | nocodazole, oncodazole, nocodazol, nocodazolum, nocidazole, nocodazole usan:inn, nocodazol inn-spanish, nocodazolum inn-latin, unii-sh1wy3r615, methyl 5-2-thenoyl-2-benzimidazolecarbamate |
| PubChem CID | 4122 |
| ChEBI | CHEBI:34892 |
| IUPAC Name | methyl N-[6-(thiophene-2-carbonyl)-1H-benzimidazol-2-yl]carbamate |
| SMILES | COC(=O)NC1=NC2=C(N1)C=C(C=C2)C(=O)C3=CC=CS3 |
| Catalog Number | Mfr. No. | Quantity | Packaging | Price | Quantity | ||||
|---|---|---|---|---|---|---|---|---|---|
| Catalog Number | Mfr. No. | Quantity | Packaging | Price | Quantity | ||||
|
AC358240100
|
Thermo Scientific Chemicals
358240100 |
10 mg | Glass bottle |
Each for $190.81
|
|
||||
Description
This Thermo Scientific Chemicals brand product was originally part of the Acros Organics product portfolio. Some documentation and label information may refer to the legacy brand. The original Acros Organics product / item code or SKU reference has not changed as a part of the brand transition to Thermo Scientific Chemicals.
Chemical Identifiers
| 31430-18-9 | |
| 301.32 | |
| KYRVNWMVYQXFEU-UHFFFAOYSA-N | |
| 4122 | |
| methyl N-[6-(thiophene-2-carbonyl)-1H-benzimidazol-2-yl]carbamate |
| C14H11N3O3S | |
| MFCD00005588 | |
| nocodazole, oncodazole, nocodazol, nocodazolum, nocidazole, nocodazole usan:inn, nocodazol inn-spanish, nocodazolum inn-latin, unii-sh1wy3r615, methyl 5-2-thenoyl-2-benzimidazolecarbamate | |
| CHEBI:34892 | |
| COC(=O)NC1=NC2=C(N1)C=C(C=C2)C(=O)C3=CC=CS3 |
Specifications
| 31430-18-9 | |
| 100.0 | |
| Brown-Orange to White | |
| 97.5% min. (HPLC) | |
| C14H11N3O3S | |
| 10 mg | |
| Solubility in water: insoluble. Other solubilities: soluble in dmso,dmf,ethanol,chloroform,acetone | |
| COC(=O)NC1=NC2=C(N1)C=C(C=C2)C(=O)C3=CC=CS3 | |
| 301.32 | |
| CHEBI:34892 | |
| 98% | |
| Nocodazole, 98% |
| 97.5 | |
| 300.0°C to 305.0°C | |
| Authentic | |
| Glass bottle | |
| MFCD00005588 | |
| nocodazole, oncodazole, nocodazol, nocodazolum, nocidazole, nocodazole usan:inn, nocodazol inn-spanish, nocodazolum inn-latin, unii-sh1wy3r615, methyl 5-2-thenoyl-2-benzimidazolecarbamate | |
| KYRVNWMVYQXFEU-UHFFFAOYSA-N | |
| methyl N-[6-(thiophene-2-carbonyl)-1H-benzimidazol-2-yl]carbamate | |
| 4122 | |
| 301.32 | |
| Powder |
Safety and Handling
GHS H Statement
Suspected of causing genetic defects.
May cause respiratory irritation.
Causes serious eye irritation.
Causes skin irritation.
Suspected of damaging the unborn child.
GHS P Statement
Wear protective gloves/protective clothing/eye protection/face protection.
Use personal protective equipment as required.
IF ON SKIN: Wash with plenty of soap and water.
Do not breathe dust/fume/gas/mist/vapors/spray
GHS Signal Word: Warning
EINECSNumber : 250-626-5
RTECSNumber : DD6521000
RUO – Research Use Only