missing translation for 'onlineSavingsMsg'
Learn More
Learn More
Thermo Scientific Chemicals Nile Red, 99%, pure
CAS: 7385-67-3 | C20H18N2O2 | 318.38 g/mol
$201.94 - $1136.01
Chemical Identifiers
| CAS | 7385-67-3 |
|---|---|
| Molecular Formula | C20H18N2O2 |
| Molecular Weight (g/mol) | 318.38 |
| MDL Number | MFCD00011639 |
| InChI Key | VOFUROIFQGPCGE-UHFFFAOYSA-N |
| Synonym | Nile blue A oxazone |
| PubChem CID | 65182 |
| ChEBI | CHEBI:52169 |
| SMILES | CCN(CC)C1=CC=C2N=C3C(OC2=C1)=CC(=O)C1=CC=CC=C31 |
| Catalog Number | Mfr. No. | Quantity | Packaging | Price | Quantity | ||||
|---|---|---|---|---|---|---|---|---|---|
| Catalog Number | Mfr. No. | Quantity | Packaging | Price | Quantity | ||||
|
AC415711000
|
Thermo Scientific Chemicals
415711000 |
100 mg | Glass bottle |
Each for $201.94
|
|
||||
|
AC415710010
|
Thermo Scientific Chemicals
415710010 |
1 g | Glass bottle |
Each for $1,136.01
|
|
||||
Description
This Thermo Scientific Chemicals brand product was originally part of the Acros Organics product portfolio. Some documentation and label information may refer to the legacy brand. The original Acros Organics product / item code or SKU reference has not changed as a part of the brand transition to Thermo Scientific Chemicals.
Chemical Identifiers
| 7385-67-3 | |
| 318.38 | |
| VOFUROIFQGPCGE-UHFFFAOYSA-N | |
| 65182 | |
| CCN(CC)C1=CC=C2N=C3C(OC2=C1)=CC(=O)C1=CC=CC=C31 |
| C20H18N2O2 | |
| MFCD00011639 | |
| Nile blue A oxazone | |
| CHEBI:52169 |
Specifications
| 203.0°C to 205.0°C | |
| 98.5 | |
| 99% | |
| MFCD00011639 | |
| 15, 6628 | |
| Solubility in water: almost insoluble. Other solubilities: soluble in acetone, acetonitrile, chloroform, thf,, ethanol, dmso, cs2, benzene, nitrobenzene, pyridin, e, hexane, diethyl ether | |
| Authentic | |
| 9-(diethylamino)benzo[a]phenoxazin-5-one | |
| 65182 | |
| 318.38 | |
| Pure | |
| 98.5% min. | |
| Maroon to Red | |
| Powder |
| 7385-67-3 | |
| 100.0 | |
| C20H18N2O2 | |
| 27, II, 468 | |
| Nile blue A oxazone | |
| VOFUROIFQGPCGE-UHFFFAOYSA-N | |
| CCN(CC)C1=CC=C2N=C3C(OC2=C1)=CC(=O)C1=CC=CC=C31 | |
| 318.38 | |
| CHEBI:52169 | |
| 99% | |
| Glass bottle | |
| Complies | |
| 100 mg | |
| Nile Red, 99% |
Safety and Handling
EINECSNumber : 230-966-0
TSCA : TSCA
RUO – Research Use Only