Learn More
Naphazoline hydrochloride, 99%
CAS: 550-99-2 | C14H14N2·ClH | 246.74 g/mol
Supplier: Thermo Scientific Chemicals 179660250
Description
This Thermo Scientific Chemicals brand product was originally part of the Acros Organics product portfolio. Some documentation and label information may refer to the legacy brand. The original Acros Organics product / item code or SKU reference has not changed as a part of the brand transition to Thermo Scientific Chemicals.
Specifications
| Naphazoline hydrochloride | |
| 550-99-2 | |
| 100.0 | |
| White | |
| 99% | |
| C14H14N2·ClH | |
| 25 g | |
| naphazoline hydrochloride, albalon, naphazoline hcl, rhinantin, rhinoperd, stricylon, naphcon, niazol, rinofug, vasocon | |
| DJDFFEBSKJCGHC-UHFFFAOYSA-N | |
| 2-(naphthalen-1-ylmethyl)-4,5-dihydro-1H-imidazole;hydrochloride | |
| 11079 | |
| 246.74 | |
| Crystalline Powder |
| 99% | |
| 98.5 | |
| 254.0°C to 260.0°C | |
| Authentic | |
| Plastic bottle | |
| MFCD00012554 | |
| 15, 6453 | |
| Solubility in water: 170g/L (20°C). | |
| C1CN=C(N1)CC2=CC=CC3=CC=CC=C32.Cl | |
| 246.74 | |
| CHEBI:7470 | |
| 99% |
Chemical Identifiers
| 550-99-2 | |
| 246.74 | |
| DJDFFEBSKJCGHC-UHFFFAOYSA-N | |
| 11079 | |
| 2-(naphthalen-1-ylmethyl)-4,5-dihydro-1H-imidazole;hydrochloride |
| C14H14N2·ClH | |
| MFCD00012554 | |
| naphazoline hydrochloride, albalon, naphazoline hcl, rhinantin, rhinoperd, stricylon, naphcon, niazol, rinofug, vasocon | |
| CHEBI:7470 | |
| C1CN=C(N1)CC2=CC=CC3=CC=CC=C32.Cl |
Safety and Handling
GHS H Statement
Fatal if swallowed.
GHS P Statement
IF SWALLOWED: Immediately call a POISON CENTER or doctor/physician.
Rinse mouth.
Do not eat,drink or smoke when using this product.
Obtain special instructions before use.
GHS Signal Word: Danger
EINECSNumber : 208-989-2
RTECSNumber : NJ4375000
TSCA : TSCA
RUO – Research Use Only