Learn More
Thermo Scientific Chemicals N(epsilon)-Acetyl-L-lysine, 99%
CAS: 692-04-6 | C8H16N2O3 | 188.23 g/mol
Supplier: Thermo Scientific Chemicals J6413903
| Quantity | 1 g |
|---|
Description
N(epsilon)-Acetyl-L-lysine is an R-chain N-acetylated α amino acid used together with other lysine analogues to differentiate and characterized various aminoacylases and regulator 2 (Sir2) enzymes/sirtuins.
This Thermo Scientific Chemicals brand product was originally part of the Alfa Aesar product portfolio. Some documentation and label information may refer to the legacy brand. The original Alfa Aesar product / item code or SKU reference has not changed as a part of the brand transition to Thermo Scientific Chemicals.
ApplicationsN(epsilon)-Acetyl-L-lysine is an R-chain N-acetylated α amino acid used together with other lysine analogues to differentiate and characterized various aminoacylases and regulator 2 (Sir2) enzymes/sirtuins.
Solubility
Soluble in water (miscible), and 80% acetic acid (50 mg/ml).
Notes
Hygroscopic. Incompatible with oxidizing agents and heat.
Chemical Identifiers
| 692-04-6 | |
| 188.23 | |
| DTERQYGMUDWYAZ-ZETCQYMHSA-N | |
| CHEBI:17752 | |
| CC(=O)NCCCC[C@H](N)C(O)=O |
| C8H16N2O3 | |
| MFCD00002639 | |
| 92832 | |
| (2S)-6-acetamido-2-aminohexanoic acid |
Specifications
| 250°C (decomposition) | |
| 692-04-6 | |
| C8H16N2O3 | |
| n-epsilon-acetyl-l-lysine, n6-acetyl-l-lysine, nepsilon-acetyl-l-lysine, n-epsilon-acetyllysine, h-lys ac-oh, n6-acetyllysine, s-6-acetamido-2-aminohexanoic acid, n 6-acetyl-l-lysine, n 6-acetyllysine, n epsilon-acetyl-l-lysine | |
| DTERQYGMUDWYAZ-ZETCQYMHSA-N | |
| (2S)-6-acetamido-2-aminohexanoic acid | |
| 1 g | |
| CHEBI:17752 | |
| 99% | |
| Powder |
| N(epsilon)-Acetyl-L-lysine | |
| White | |
| MFCD00002639 | |
| Soluble in water (miscible),and 80% acetic acid (50mg/ml). | |
| CC(=O)NCCCC[C@H](N)C(O)=O | |
| 188.23 | |
| 92832 | |
| 188.2 | |
| Hygroscopic |
Safety and Handling
EINECSNumber : 211-725-9
TSCA : No
Recommended Storage : Store at -20°C; Store under Nitrogen