Learn More
Thermo Scientific™ N-Acetyl-Asp-Glu-Val-Asp p-nitroanilide
CAS: 189950-66-1 | C26H34N6O13, C26H34N6O13 | 638.59 g/mol
Supplier: Thermo Scientific™ J65878MB
| Quantity | 25 mg |
|---|
Description
N-Acetyl-Asp-Glu-Val-Asp p-nitroanilide is an chromogenic substrate for Caspase 3 and CCP-32.
This Thermo Scientific brand product was originally part of the Alfa Aesar product portfolio. Some documentation and label information may refer to the legacy brand. The original Alfa Aesar product / item code or SKU reference has not changed as a part of the brand transition to Thermo Scientific.
Chemical Identifiers
| 189950-66-1 | |
| 638.59 | |
| Ac-DEVD-pNA | |
| CC(C)C(NC(=O)C(CCC(O)=O)NC(=O)C(CC(O)=O)NC(C)=O)C(=O)NC(CC(O)=O)C(=O)NC1=CC=C(C=C1)[N+]([O-])=O |
| C26H34N6O13 | |
| GGXRLUDNGFFUKI-UHFFFAOYNA-N | |
| 4-{[1-({2-carboxy-1-[(4-nitrophenyl)carbamoyl]ethyl}carbamoyl)-2-methylpropyl]carbamoyl}-4-(3-carboxy-2-acetamidopropanamido)butanoic acid |
Specifications
| 25 mg | |
| -30°C to -10°C | |
| 189950-66-1 | |
| 638.58g/mol | |
| Signal Transduction Reagent | |
| GGXRLUDNGFFUKI-UHFFFAOYNA-N | |
| 4-{[1-({2-carboxy-1-[(4-nitrophenyl)carbamoyl]ethyl}carbamoyl)-2-methylpropyl]carbamoyl}-4-(3-carboxy-2-acetamidopropanamido)butanoic acid |
| White | |
| A colorimetric substrate for caspase-3 | |
| C26H34N6O13 | |
| Ac-DEVD-pNA | |
| Powder | |
| CC(C)C(NC(=O)C(CCC(O)=O)NC(=O)C(CC(O)=O)NC(C)=O)C(=O)NC(CC(O)=O)C(=O)NC1=CC=C(C=C1)[N+]([O-])=O | |
| 638.59 |
Safety and Handling
Recommended Storage : Store at -20°C