missing translation for 'onlineSavingsMsg'
Learn More
Learn More
Methyl Red, 0.1% Aqueous, pH 4.2 to 6.3 Pink to Yellow, Certified, LabChem™
Supplier: LabChem LC171201
| Quantity | 500 mL |
|---|
Chemical Identifiers
| C15H14N3NaO2 | |
| GNTPCYMJCJNRQB-UHFFFAOYSA-M | |
| sodium;2-[[4-(dimethylamino)phenyl]diazenyl]benzoate |
Specifications
| Methyl Red | |
| 845-10-3 , 7732-18-5 | |
| C15H14N3NaO2 | |
| Soluble in water | |
| GNTPCYMJCJNRQB-UHFFFAOYSA-M | |
| sodium;2-[[4-(dimethylamino)phenyl]diazenyl]benzoate | |
| 4465632 | |
| Certified | |
| Nitrogen oxides; Carbon monoxide; Carbon dioxide | |
| 500 mL |
| 0.1% Aqueous, pH 4.2 to 6.3 Pink to Yellow | |
| 99.9, 0.1 | |
| C15H14N3O2Na | |
| Passes Test | |
| CN(C)C1=CC=C(C=C1)N=NC2=CC=CC=C2C(=O)[O-].[Na+] | |
| 291.286 | |
| 291.28 | |
| Poly Bottle | |
| Orange | |
| Liquid |
Safety and Handling
GHS H Statement
Solution is not hazardous.
GHS P Statement
If in contact with skin or eyes, rinse thoroughly with water for 15-20 minutes.
If swallowed, get medical attention.
Recommended Storage : Room Temperature