missing translation for 'onlineSavingsMsg'
Learn More
Learn More
Methyl Orange, 0.05% Aqueous, pH 3.2 to 4.4 Red to Yellow, Certified, LabChem™
Supplier: LabChem LC170002
Specifications
| Methyl Orange | |
| 547-58-0,7732-18-5 | |
| C14H14N3NaO3S | |
| Soluble in water | |
| STZCRXQWRGQSJD-UHFFFAOYSA-M | |
| sodium;4-[[4-(dimethylamino)phenyl]diazenyl]benzenesulfonate | |
| 23673835 | |
| Certified | |
| Carbon monoxide; Carbon dioxide; Nitrogen oxides; Sulfur compounds | |
| 1 L |
| 0.05% Aqueous, pH 3.2 to 4.4 Red to Yellow | |
| 99.95,0.05 | |
| 4-NaOSO2C6H4N:NC6H4-4-N(CH3)2 | |
| Passes Test | |
| CN(C)C1=CC=C(C=C1)N=NC2=CC=C(C=C2)S(=O)(=O)[O-].[Na+] | |
| 327.334 | |
| 327.34 | |
| Poly Bottle | |
| Orange | |
| Liquid |
Chemical Identifiers
| 547-58-0 | |
| 327.334 | |
| 23673835 | |
| CN(C)C1=CC=C(C=C1)N=NC2=CC=C(C=C2)S(=O)(=O)[O-].[Na+] |
| C14H14N3NaO3S | |
| STZCRXQWRGQSJD-UHFFFAOYSA-M | |
| sodium;4-[[4-(dimethylamino)phenyl]diazenyl]benzenesulfonate |
Safety and Handling
GHS H Statement
Solution is not hazardous.
GHS P Statement
If in contact with skin or eyes, rinse thoroughly with water for 15-20 minutes.
If swallowed, get medical attention.
Recommended Storage : Room Temperature