missing translation for 'onlineSavingsMsg'
Learn More
Learn More
Thermo Scientific Chemicals MES sodium salt, 99%
CAS: 71119-23-8 | C6H12NNaO4S | 217.215 g/mol
$90.97 - $944.26
Chemical Identifiers
| CAS | 71119-23-8 |
|---|---|
| Molecular Formula | C6H12NNaO4S |
| Molecular Weight (g/mol) | 217.215 |
| MDL Number | MFCD00065473 |
| InChI Key | IRHWMYKYLWNHTL-UHFFFAOYSA-M |
| PubChem CID | 23673676 |
| ChEBI | CHEBI:62955 |
| IUPAC Name | sodium;2-morpholin-4-ylethanesulfonate |
| SMILES | C1COCCN1CCS(=O)(=O)[O-].[Na+] |
| Catalog Number | Mfr. No. | Quantity | Packaging | Price | Quantity | ||||
|---|---|---|---|---|---|---|---|---|---|
| Catalog Number | Mfr. No. | Quantity | Packaging | Price | Quantity | ||||
|
AC397350250
|
Thermo Scientific Chemicals
397350250 |
25 g | Plastic bottle |
Each for $90.97
|
|
||||
|
AC397351000
|
Thermo Scientific Chemicals
397351000 |
100 g | Plastic bottle |
Each for $251.41
|
|
||||
|
AC397355000
|
Thermo Scientific Chemicals
397355000 |
500 g | Plastic bottle |
Each for $944.26
|
|
||||
Description
This Thermo Scientific Chemicals brand product was originally part of the Acros Organics product portfolio. Some documentation and label information may refer to the legacy brand. The original Acros Organics product / item code or SKU reference has not changed as a part of the brand transition to Thermo Scientific Chemicals.
Biological bufferChemical Identifiers
| 71119-23-8 | |
| 217.215 | |
| IRHWMYKYLWNHTL-UHFFFAOYSA-M | |
| CHEBI:62955 | |
| C1COCCN1CCS(=O)(=O)[O-].[Na+] |
| C6H12NNaO4S | |
| MFCD00065473 | |
| 23673676 | |
| sodium;2-morpholin-4-ylethanesulfonate |
Specifications
| 0.03 max. (10% in water) 1 cm cell vs water at 280nm, 0.05 max. (10% in water) 1 cm cell vs water at 260nm | |
| White | |
| 25 g | |
| Authentic | |
| MFCD00065473 | |
| Solubility in water: 0.5g/L. | |
| C1COCCN1CCS(=O)(=O)[O-].[Na+] | |
| 217.215 | |
| CHEBI:62955 | |
| ≥98.5% (after ion exchange) |
| 71119-23-8 | |
| Powder | |
| 99% | |
| C6H12NNaO4S | |
| Plastic bottle | |
| IRHWMYKYLWNHTL-UHFFFAOYSA-M | |
| sodium;2-morpholin-4-ylethanesulfonate | |
| 23673676 | |
| 217.22 | |
| MES sodium salt |
RUO – Research Use Only