missing translation for 'onlineSavingsMsg'
Learn More
Learn More
Thermo Scientific Chemicals MES sodium salt, 99%
CAS: 71119-23-8 | C6H12NNaO4S | 217.215 g/mol
Supplier: Thermo Scientific Chemicals 397351000
Description
This Thermo Scientific Chemicals brand product was originally part of the Acros Organics product portfolio. Some documentation and label information may refer to the legacy brand. The original Acros Organics product / item code or SKU reference has not changed as a part of the brand transition to Thermo Scientific Chemicals.
Biological bufferSpecifications
| 0.03 max. (10% in water) 1 cm cell vs water at 280nm, 0.05 max. (10% in water) 1 cm cell vs water at 260nm | |
| 71119-23-8 | |
| Powder | |
| 99% | |
| C6H12NNaO4S | |
| Plastic bottle | |
| IRHWMYKYLWNHTL-UHFFFAOYSA-M | |
| sodium;2-morpholin-4-ylethanesulfonate | |
| 23673676 | |
| 217.22 |
| MES sodium salt | |
| White | |
| 100 g | |
| Authentic | |
| MFCD00065473 | |
| Solubility in water: 0.5g/L. | |
| C1COCCN1CCS(=O)(=O)[O-].[Na+] | |
| 217.215 | |
| CHEBI:62955 | |
| ≥98.5% (after ion exchange) |
Chemical Identifiers
| 71119-23-8 | |
| 217.215 | |
| IRHWMYKYLWNHTL-UHFFFAOYSA-M | |
| CHEBI:62955 | |
| C1COCCN1CCS(=O)(=O)[O-].[Na+] |
| C6H12NNaO4S | |
| MFCD00065473 | |
| 23673676 | |
| sodium;2-morpholin-4-ylethanesulfonate |
RUO – Research Use Only