Learn More
MES (Fine White Crystals), Fisher BioReagents
Commonly used buffering agent
Supplier: Fisher BioReagents FLBP300100
Description
This biological buffer has a usable pH range of 5.5 to 6.7.Specifications
| MES | |
| 145224-94-8 | |
| 3.5 to 4.1 | |
| 100 g | |
| DNase- and RNase-Free | |
| ≥98 % | |
| OCH2CH2NCH2CH2(CH2CH2SO3H) | |
| 15, 5972 | |
| 2-(4-Morpholino)ethane Sulfonic Acid, 2-(N-Morpholino)ethanesulfonic acid hydrate | |
| C1COCCN1CCS(=O)(=O)O.O | |
| 213.248 | |
| 213.2 |
| 300°C | |
| White | |
| Powder or Solid | |
| DNase free | |
| Pass Test | |
| C6H15NO5S | |
| Glass Bottle | |
| Negligible | |
| MIIIXQJBDGSIKL-UHFFFAOYSA-N | |
| 2-morpholin-4-ylethanesulfonic acid;hydrate | |
| 16218417 | |
| ≥98% |
Chemical Identifiers
| 145224-94-8 | |
| 213.248 | |
| 2-(4-Morpholino)ethane Sulfonic Acid, 2-(N-Morpholino)ethanesulfonic acid hydrate | |
| 2-morpholin-4-ylethanesulfonic acid;hydrate |
| C6H15NO5S | |
| MIIIXQJBDGSIKL-UHFFFAOYSA-N | |
| 16218417 | |
| C1COCCN1CCS(=O)(=O)O.O |
Safety and Handling
WARNING!
Emergency Overview
Harmful if swallowed. Wear personal protective equipment. Ensure adequate ventilation. Do not get in eyes, on skin, or on clothing. Avoid ingestion and inhalation. Use personal protective equipment. Wash off immediately with plenty of water for at least 15 minutes. Obtain medical attention. Rinse immediately with plenty of water, also under the eyelids, for at least 15 minutes. Obtain medical attention. Move to fresh air. If breathing is difficult, give oxygen. If breathing is difficult, give oxygen. Do not use mouth-to-mouth resuscitation if victim ingested or inhaled the substance; induce artifici.
NFPA
Health:2
Flammability:1
Instability:0
Recommended Storage : RT