missing translation for 'onlineSavingsMsg'
Learn More
Learn More
Mercuric Acetate, 25 g/L in Glacial Acetic Acid, Ricca Chemical
Supplier: Ricca Chemical Company 46251
Alert:
The products indicated contain mercury. Don't put products containing mercury in the trash. Products containing mercury are to be recycled or disposed of as hazardous waste. Products containing mercury may be regulated by Local, State, or Federal Laws. Some products containing mercury are not available for sale in some states.
Specifications
| Mercuric Acetate | |
| 1600-27-7 , 64-19-7 | |
| 100.0,2.33 | |
| mercury 2+ ion acetic acid | |
| CC(=O)[O-].CC(=O)[O-].[Hg+2] | |
| 318.68 | |
| CHEBI:33211 | |
| Safety-coated Glass Bottle | |
| <2 | |
| Liquid |
| Colorless | |
| 96.0,2.24 | |
| C4H6HgO4 | |
| BRMYZIKAHFEUFJ-UHFFFAOYSA-L | |
| mercury(2+);diacetate | |
| 15337 | |
| Laboratory | |
| Glacial Acetic Acid | |
| 4 L | |
| 25g/L |
Chemical Identifiers
| 1600-27-7 | |
| 318.68 | |
| mercury 2+ ion acetic acid | |
| CHEBI:33211 | |
| CC(=O)[O-].CC(=O)[O-].[Hg+2] |
| C4H6HgO4 | |
| BRMYZIKAHFEUFJ-UHFFFAOYSA-L | |
| 15337 | |
| mercury(2+);diacetate |