missing translation for 'onlineSavingsMsg'
Learn More
Learn More
Please login to your online account to display your discounted pricing
L-Tyrosine, MP Biomedicals™
Manufacturer: MP Biochemicals LLC 10318391
Specifications
| L-Tyrosine | |
| 0.97 | |
| MFCD00002606 | |
| OUYCCCASQSFEME-QMMMGPOBSA-N | |
| (2S)-2-amino-3-(4-hydroxyphenyl)propanoic acid | |
| 6057 | |
| 181.19 | |
| 1.4g/mL | |
| 1kg |
| 60-18-4 | |
| C9H11NO3 | |
| 2s-2-amino-3-4-hydroxyphenyl propanoic acid | |
| C1=CC(=CC=C1CC(C(=O)O)N)O | |
| 181.191 | |
| CHEBI:17895 | |
| Powder | |
| White |
Chemical Identifiers
| 60-18-4 | |
| 181.191 | |
| OUYCCCASQSFEME-QMMMGPOBSA-N | |
| 6057 | |
| (2S)-2-amino-3-(4-hydroxyphenyl)propanoic acid |
| C9H11NO3 | |
| MFCD00002606 | |
| 2s-2-amino-3-4-hydroxyphenyl propanoic acid | |
| CHEBI:17895 | |
| C1=CC(=CC=C1CC(C(=O)O)N)O |
Safety and Handling
EINECSNumber : 200-460-4
Recommended Storage : Store at Room Temperature (15 to 30°C).