missing translation for 'onlineSavingsMsg'
Learn More
Learn More
Thermo Scientific Chemicals Inosine, 98+%
CAS: 58-63-9 | C10H12N4O5 | 268.23 g/mol
$58.42 - $407.78
Chemical Identifiers
| CAS | 58-63-9 |
|---|---|
| Molecular Formula | C10H12N4O5 |
| Molecular Weight (g/mol) | 268.23 |
| MDL Number | MFCD00066770 |
| InChI Key | UGQMRVRMYYASKQ-YPLCUDRINA-N |
| Synonym | inosine, hypoxanthosine, ribonosine, atorel, oxiamin, trophicardyl, selfer, pantholic-l, panholic-l, hypoxanthine riboside |
| PubChem CID | 6021 |
| ChEBI | CHEBI:17596 |
| IUPAC Name | 9-[(2R,3R,4S,5R)-3,4-dihydroxy-5-(hydroxymethyl)oxolan-2-yl]-3H-purin-6-one |
| SMILES | OC[C@H]1O[C@H]([C@H](O)[C@@H]1O)N1C=NC2=C1N=CNC2=O |
| Catalog Number | Mfr. No. | Quantity | Price | Quantity | |||||
|---|---|---|---|---|---|---|---|---|---|
| Catalog Number | Mfr. No. | Quantity | Price | Quantity | |||||
|
AAA1445906
|
Thermo Scientific Chemicals
A1445906 |
5 g |
Each for $58.42
|
|
|||||
|
AAA1445914
|
Thermo Scientific Chemicals
A1445914 |
25 g |
Each for $140.86
|
|
|||||
|
AAA1445922
|
Thermo Scientific Chemicals
A1445922 |
100 g |
Each for $407.78
|
|
|||||
Description
Suppresses the increase of glucose and insulin in the blood
This Thermo Scientific Chemicals brand product was originally part of the Alfa Aesar product portfolio. Some documentation and label information may refer to the legacy brand. The original Alfa Aesar product / item code or SKU reference has not changed as a part of the brand transition to Thermo Scientific Chemicals.
Chemical Identifiers
| 58-63-9 | |
| 268.23 | |
| UGQMRVRMYYASKQ-YPLCUDRINA-N | |
| 6021 | |
| 9-[(2R,3R,4S,5R)-3,4-dihydroxy-5-(hydroxymethyl)oxolan-2-yl]-3H-purin-6-one |
| C10H12N4O5 | |
| MFCD00066770 | |
| inosine, hypoxanthosine, ribonosine, atorel, oxiamin, trophicardyl, selfer, pantholic-l, panholic-l, hypoxanthine riboside | |
| CHEBI:17596 | |
| OC[C@H]1O[C@H]([C@H](O)[C@@H]1O)N1C=NC2=C1N=CNC2=O |
Specifications
| 58-63-9 | |
| C10H12N4O5 | |
| 5 g | |
| 14,4975 | |
| UGQMRVRMYYASKQ-YPLCUDRINA-N | |
| OC[C@H]1O[C@H]([C@H](O)[C@@H]1O)N1C=NC2=C1N=CNC2=O | |
| 268.23 | |
| CHEBI:17596 | |
| ≥98% |
| 212°C to 215°C (decomposition) | |
| MFCD00066770 | |
| 624889 | |
| inosine, hypoxanthosine, ribonosine, atorel, oxiamin, trophicardyl, selfer, pantholic-l, panholic-l, hypoxanthine riboside | |
| −52° (c=1 in Water) | |
| 9-[(2R,3R,4S,5R)-3,4-dihydroxy-5-(hydroxymethyl)oxolan-2-yl]-3H-purin-6-one | |
| 6021 | |
| 268.23 | |
| Inosine |
Safety and Handling
EINECSNumber : 200-390-4
RTECSNumber : NW7460000
TSCA : Yes
Recommended Storage : Ambient temperatures
RUO – Research Use Only