Learn More
Thermo Scientific Chemicals Inosine, 98+%
CAS: 58-63-9 | C10H12N4O5 | 268.23 g/mol
Supplier: Thermo Scientific Chemicals A1445914
Description
Suppresses the increase of glucose and insulin in the blood
This Thermo Scientific Chemicals brand product was originally part of the Alfa Aesar product portfolio. Some documentation and label information may refer to the legacy brand. The original Alfa Aesar product / item code or SKU reference has not changed as a part of the brand transition to Thermo Scientific Chemicals.
Specifications
| Inosine | |
| 212°C to 215°C (decomposition) | |
| MFCD00066770 | |
| 624889 | |
| inosine, hypoxanthosine, ribonosine, atorel, oxiamin, trophicardyl, selfer, pantholic-l, panholic-l, hypoxanthine riboside | |
| −52° (c=1 in Water) | |
| 9-[(2R,3R,4S,5R)-3,4-dihydroxy-5-(hydroxymethyl)oxolan-2-yl]-3H-purin-6-one | |
| 6021 | |
| 268.23 |
| 58-63-9 | |
| C10H12N4O5 | |
| 25 g | |
| 14,4975 | |
| UGQMRVRMYYASKQ-YPLCUDRINA-N | |
| OC[C@H]1O[C@H]([C@H](O)[C@@H]1O)N1C=NC2=C1N=CNC2=O | |
| 268.23 | |
| CHEBI:17596 | |
| ≥98% |
Chemical Identifiers
| 58-63-9 | |
| 268.23 | |
| UGQMRVRMYYASKQ-YPLCUDRINA-N | |
| 6021 | |
| 9-[(2R,3R,4S,5R)-3,4-dihydroxy-5-(hydroxymethyl)oxolan-2-yl]-3H-purin-6-one |
| C10H12N4O5 | |
| MFCD00066770 | |
| inosine, hypoxanthosine, ribonosine, atorel, oxiamin, trophicardyl, selfer, pantholic-l, panholic-l, hypoxanthine riboside | |
| CHEBI:17596 | |
| OC[C@H]1O[C@H]([C@H](O)[C@@H]1O)N1C=NC2=C1N=CNC2=O |
Safety and Handling
EINECSNumber : 200-390-4
RTECSNumber : NW7460000
TSCA : Yes
Recommended Storage : Ambient temperatures
RUO – Research Use Only