missing translation for 'onlineSavingsMsg'
Learn More
Learn More
MilliporeSigma™ HEPES, Sodium Salt, ULTROL™ Grade, Calbiochem™,
A zwitterionic N-substituted aminosulfonic acid buffer
Supplier: MilliporeSigma™ 3913331KG
Description
HygroscopicSpecifications
| zwitterionic N-substituted aminosulfonic acid buffer | |
| 1 kg | |
| ≥99.0% | |
| MFCD00036463 | |
| Soluble in water | |
| [Na+].OCCN1CCN(CCS([O-])(=O)=O)CC1 | |
| 260.28 | |
| CHEBI:46758 | |
| ULTROL™ |
| 75277-39-3 | |
| by titration (dry basis) | |
| C8H17N2NaO4S | |
| N-2-Hydroxyethylpiperazine-N'-2-ethanesulfonic Acid, Na | |
| RDZTWEVXRGYCFV-UHFFFAOYSA-M | |
| sodium 2-[4-(2-hydroxyethyl)piperazin-1-yl]ethane-1-sulfonate | |
| 2724248 | |
| 260.3 |
Chemical Identifiers
| 75277-39-3 | |
| 260.28 | |
| RDZTWEVXRGYCFV-UHFFFAOYSA-M | |
| 2724248 | |
| sodium 2-[4-(2-hydroxyethyl)piperazin-1-yl]ethane-1-sulfonate |
| C8H17N2NaO4S | |
| MFCD00036463 | |
| N-2-Hydroxyethylpiperazine-N'-2-ethanesulfonic Acid, Na | |
| CHEBI:46758 | |
| [Na+].OCCN1CCN(CCS([O-])(=O)=O)CC1 |
Safety and Handling
Recommended Storage : 15°C to 30°C (Do not freeze); Store in accordance with local regulations. Store in original container, protected from direct sunlight. Keep container tightly closed and sealed until ready for use.