missing translation for 'onlineSavingsMsg'
Learn More
Learn More
HEPES Sodium Salt, Biological Buffer, High Purity, 98%, Spectrum™ Chemical
Supplier: Spectrum Chemical Mfg Cor H1084500GM
Specifications
| 0.05 A.U. (0.1 M Solution at 260 nm) | |
| 75277-39-3 | |
| Alkaline | |
| 500 g | |
| C8H17N2NaO4S | |
| RDZTWEVXRGYCFV-UHFFFAOYSA-M | |
| sodium 2-[4-(2-hydroxyethyl)piperazin-1-yl]ethane-1-sulfonate | |
| 98% |
| 4-(2-Hydroxyethyl)-1-Piperazineethanesulfonic Acid Sodium Salt | |
| 1 | |
| Crystalline | |
| 0.04 | |
| Amber Glass Bottle | |
| [Na+].OCCN1CCN(CCS([O-])(=O)=O)CC1 | |
| 260.28 | |
| High Purity |
Chemical Identifiers
| 75277-39-3 | |
| 260.28 | |
| sodium 2-[4-(2-hydroxyethyl)piperazin-1-yl]ethane-1-sulfonate |
| C8H17N2NaO4S | |
| RDZTWEVXRGYCFV-UHFFFAOYSA-M | |
| [Na+].OCCN1CCN(CCS([O-])(=O)=O)CC1 |
CAUTION: For manufacturing or laboratory use only. Read and understand the label and Safety Data Sheet (SDS) prior to use.