missing translation for 'onlineSavingsMsg'
Learn More
Learn More
Please login to your online account to display your discounted pricing
HEPES sodium salt, ≥99%, MP Biomedicals™
HEPES is widely used in many biochemical reactions and as a buffering agent in some cell culture media. It is used in a protein deposition technique in electron microscopy because it did not affect metal substrates
Manufacturer: Mp Biomedicals 0219482890
Specifications
| HEPES sodium salt | |
| ≥99% | |
| MFCD00036463 | |
| RDZTWEVXRGYCFV-UHFFFAOYSA-M | |
| sodium;2-[4-(2-hydroxyethyl)piperazin-1-yl]ethanesulfonate | |
| 2724248 | |
| 260.3 | |
| White |
| 75277-39-3 | |
| C8H17N2NaO4S | |
| 4-(2-Hydroxyethyl)piperazine-1-ethanesulfonic acid sodium salt, N-(2-Hydroxyethyl)piperazine-N'-(2-ethanesulfonic acid) sodium salt | |
| C1CN(CCN1CCO)CCS(=O)(=O)[O-].[Na+] | |
| 260.284 | |
| CHEBI:46758 | |
| Powder | |
| 500g |
Chemical Identifiers
| 75277-39-3 | |
| 260.284 | |
| RDZTWEVXRGYCFV-UHFFFAOYSA-M | |
| 2724248 | |
| sodium;2-[4-(2-hydroxyethyl)piperazin-1-yl]ethanesulfonate |
| C8H17N2NaO4S | |
| MFCD00036463 | |
| 4-(2-Hydroxyethyl)piperazine-1-ethanesulfonic acid sodium salt, N-(2-Hydroxyethyl)piperazine-N'-(2-ethanesulfonic acid) sodium salt | |
| CHEBI:46758 | |
| C1CN(CCN1CCO)CCS(=O)(=O)[O-].[Na+] |
Safety and Handling
EINECSNumber : 278-169-7