missing translation for 'onlineSavingsMsg'
Learn More
Learn More
MilliporeSigma™ HEPES, Free Acid, OmniPur™, Calbiochem™,
Supplier: MilliporeSigma™ 53405KG
Specifications
| HEPES, Free Acid | |
| 7365-45-9 | |
| None Detected | |
| ≥99.0% | |
| MFCD00006158 | |
| N-2-Hydroxyethylpiperazine-N'-2-ethanesulfonic acid | |
| JKMHFZQWWAIEOD-UHFFFAOYSA-N | |
| 2-[4-(2-hydroxyethyl)piperazin-1-yl]ethane-1-sulfonic acid | |
| 23831 | |
| 238.3 |
| 210°C to 215°C | |
| 5 kg | |
| Dried basis | |
| C8H18N2O4S | |
| None Detected | |
| Soluble in water | |
| OCCN1CCN(CCS(O)(=O)=O)CC1 | |
| 238.30 | |
| CHEBI:42334 | |
| Molecular Biology |
Chemical Identifiers
| 7365-45-9 | |
| 238.30 | |
| JKMHFZQWWAIEOD-UHFFFAOYSA-N | |
| 23831 | |
| 2-[4-(2-hydroxyethyl)piperazin-1-yl]ethane-1-sulfonic acid |
| C8H18N2O4S | |
| MFCD00006158 | |
| N-2-Hydroxyethylpiperazine-N'-2-ethanesulfonic acid | |
| CHEBI:42334 | |
| OCCN1CCN(CCS(O)(=O)=O)CC1 |
Safety and Handling
Recommended Storage : 15°C to 30°C (Do not freeze); Store in accordance with local regulations. Store in original container, protected from direct sunlight. Keep container tightly closed and sealed until ready for use.