missing translation for 'onlineSavingsMsg'
Learn More
Learn More
Thermo Scientific Chemicals HEPES free acid, 99+%, for molecular biology, DNase, Rnase and Protease free
CAS: 7365-45-9 | C8H18N2O4S | 238.30 g/mol
Supplier: Thermo Scientific Chemicals 329850500
Description
This Thermo Scientific Chemicals brand product was originally part of the Acros Organics product portfolio. Some documentation and label information may refer to the legacy brand. The original Acros Organics product / item code or SKU reference has not changed as a part of the brand transition to Thermo Scientific Chemicals.
Biological bufferSpecifications
| (0.5 M in water), (0.5 M in water) at 0nm, 0.1 max. at 260nm, 0.1 max. at 280nm | |
| (0.5M in water) | |
| 7365-45-9 | |
| 5 to 6.5 (0.5 M aq. soln.) | |
| 50 g | |
| Authentic | |
| C8H18N2O4S | |
| Plastic bottle | |
| 15, 4689 | |
| Solubility in water: 704g/L (20°C). | |
| OCCN1CCN(CCS(O)(=O)=O)CC1 | |
| 238.30 | |
| CHEBI:42334 | |
| ≥99% |
| HEPES free acid | |
| 234.0°C to 238.0°C | |
| White | |
| Crystalline Powder | |
| 99+% | |
| 0.5% max. (105°C) | |
| MFCD00006158 | |
| 23, V,2, 379 | |
| 2-[4-(2-Hydroxyethyl)-1-piperazine]ethanesulfonic acid | |
| JKMHFZQWWAIEOD-UHFFFAOYSA-N | |
| 2-[4-(2-hydroxyethyl)piperazin-1-yl]ethane-1-sulfonic acid | |
| 23831 | |
| 238.3 | |
| Molecular Biology |
Chemical Identifiers
| 7365-45-9 | |
| 238.30 | |
| JKMHFZQWWAIEOD-UHFFFAOYSA-N | |
| 23831 | |
| 2-[4-(2-hydroxyethyl)piperazin-1-yl]ethane-1-sulfonic acid |
| C8H18N2O4S | |
| MFCD00006158 | |
| 2-[4-(2-Hydroxyethyl)-1-piperazine]ethanesulfonic acid | |
| CHEBI:42334 | |
| OCCN1CCN(CCS(O)(=O)=O)CC1 |
Safety and Handling
HYGROSCOPIC
EINECSNumber : 230-907-9
RTECSNumber : TL6809000
TSCA : TSCA
RUO – Research Use Only