missing translation for 'onlineSavingsMsg'
Learn More
Learn More
Thermo Scientific Chemicals DL-alpha-Tocopheryl acetate, 98%
CAS: 7695-91-2 | C31H52O3 | 472.75 g/mol
Supplier: Thermo Scientific Chemicals 421070010
Description
This Thermo Scientific Chemicals brand product was originally part of the Acros Organics product portfolio. Some documentation and label information may refer to the legacy brand. The original Acros Organics product / item code or SKU reference has not changed as a part of the brand transition to Thermo Scientific Chemicals.
Specifications
| DL-α-Tocopheryl acetate | |
| Green to Yellow | |
| Authentic | |
| Glass bottle | |
| MFCD00072042 | |
| 15, 9653 | |
| Solubility in water: slightly soluble | |
| CC1=C2C(=C(C(=C1C)OC(=O)C)C)CCC(O2)(C)CCCC(C)CCCC(C)CCCC(C)C | |
| 472.75 | |
| CHEBI:32321 | |
| 98% |
| 7695-91-2 | |
| 257°C | |
| 97.5% min. (GC) | |
| C31H52O3 | |
| 1 g | |
| vitamin e acetate, tocopherol acetate, alpha-tocopherol acetate, alfacol, ecofrol, d-alpha-tocopherol acetate, contopheron, tofaxin, ephynal acetate, econ | |
| ZAKOWWREFLAJOT-CEFNRUSXSA-N | |
| [(2R)-2,5,7,8-tetramethyl-2-[(4R,8R)-4,8,12-trimethyltridecyl]-3,4-dihydrochromen-6-yl] acetate | |
| 86472 | |
| 472.75 | |
| Viscous Liquid |
Chemical Identifiers
| 7695-91-2 | |
| 472.75 | |
| ZAKOWWREFLAJOT-CEFNRUSXSA-N | |
| 86472 | |
| [(2R)-2,5,7,8-tetramethyl-2-[(4R,8R)-4,8,12-trimethyltridecyl]-3,4-dihydrochromen-6-yl] acetate |
| C31H52O3 | |
| MFCD00072042 | |
| vitamin e acetate, tocopherol acetate, alpha-tocopherol acetate, alfacol, ecofrol, d-alpha-tocopherol acetate, contopheron, tofaxin, ephynal acetate, econ | |
| CHEBI:32321 | |
| CC1=C2C(=C(C(=C1C)OC(=O)C)C)CCC(O2)(C)CCCC(C)CCCC(C)CCCC(C)C |
Safety and Handling
EINECSNumber : 231-710-
RUO – Research Use Only