Learn More
Dibenzoyl peroxide, 75%, remainder water
CAS: 94-36-0 | C14H10O4 | 242.23 g/mol
$60.77 - $413.25
Chemical Identifiers
| CAS | 94-36-0 |
|---|---|
| Molecular Formula | C14H10O4 |
| Molecular Weight (g/mol) | 242.23 |
| MDL Number | MFCD00003071 |
| InChI Key | OMPJBNCRMGITSC-UHFFFAOYSA-N |
| Synonym | benzoyl peroxide, dibenzoyl peroxide, peroxide, dibenzoyl, benzoperoxide, benzoyl superoxide, acetoxyl, lucidol, benoxyl, panoxyl, benzol peroxide |
| PubChem CID | 7187 |
| ChEBI | CHEBI:82405 |
| IUPAC Name | benzoyl benzenecarboperoxoate |
| SMILES | C1=CC=C(C=C1)C(=O)OOC(=O)C2=CC=CC=C2 |
| Catalog Number | Mfr. No. | Quantity | Packaging | Price | Quantity | ||||
|---|---|---|---|---|---|---|---|---|---|
| Catalog Number | Mfr. No. | Quantity | Packaging | Price | Quantity | ||||
|
AC211780050
|
Thermo Scientific Chemicals
211780050 |
5 g | Plastic bottle |
Each for $60.77
|
|
||||
|
AC211781000
|
Thermo Scientific Chemicals
211781000 |
100 g | Plastic bottle |
Each for $70.85
|
|
||||
|
AC211780010
|
Thermo Scientific Chemicals
211780010 |
1 kg | Plastic bottle |
Each for $413.25
|
|
||||
Description
This Thermo Scientific Chemicals brand product was originally part of the Acros Organics product portfolio. Some documentation and label information may refer to the legacy brand. The original Acros Organics product / item code or SKU reference has not changed as a part of the brand transition to Thermo Scientific Chemicals.
Radical initiatorsChemical Identifiers
| 94-36-0 | |
| 242.23 | |
| OMPJBNCRMGITSC-UHFFFAOYSA-N | |
| 7187 | |
| benzoyl benzenecarboperoxoate |
| C14H10O4 | |
| MFCD00003071 | |
| benzoyl peroxide, dibenzoyl peroxide, peroxide, dibenzoyl, benzoperoxide, benzoyl superoxide, acetoxyl, lucidol, benoxyl, panoxyl, benzol peroxide | |
| CHEBI:82405 | |
| C1=CC=C(C=C1)C(=O)OOC(=O)C2=CC=CC=C2 |
Specifications
| 94-36-0,7732-18-5 | |
| White | |
| C14H10O4 | |
| MFCD00003071 | |
| 09, 179 | |
| 15, 1119 | |
| Solubility in water: insoluble. Other solubilities: sparingly soluble in alcohol,soluble in benzene,chloroform,ether and acetone,1g/40 mL carbon disulfide,1g/40 mL olive oil | |
| C1=CC=C(C=C1)C(=O)OOC(=O)C2=CC=CC=C2 | |
| 242.23 | |
| CHEBI:82405 | |
| 75% | |
| Dibenzoyl peroxide, 75%, remainder water |
| 104.0°C to 106.0°C | |
| Plastic bottle | |
| (C6H5CO)2O2 | |
| 5 g | |
| 01,196; 04,122; 05,182; 06,160; 07,89; 12,157; 15,146; 17,367 | |
| benzoyl peroxide, dibenzoyl peroxide, peroxide, dibenzoyl, benzoperoxide, benzoyl superoxide, acetoxyl, lucidol, benoxyl, panoxyl, benzol peroxide | |
| OMPJBNCRMGITSC-UHFFFAOYSA-N | |
| benzoyl benzenecarboperoxoate | |
| 7187 | |
| 242.23 | |
| Wet Granular Powder |
Safety and Handling
GHS H Statement
May cause an allergic skin reaction.
Causes serious eye irritation.
Heating may cause a fire.
Very toxic to aquatic life with long lasting effects.
GHS P Statement
Keep away from heat/sparks/open flames/hot surfaces.
- No smoking.
Keep/Store away from clothing/ combustible materials.
Wear protective gloves/protective clothing/eye protection/face protection.
IF ON SKIN: Wash
GHS Signal Word: Danger
EINECSNumber : 202-327-6
RTECSNumber : DM8575000
TSCA : TSCA
RUO – Research Use Only