Learn More
D-Sucrose (Molecular Biology), Fisher BioReagents
For the preparation of density gradients for DNA ultracentrifugation
Supplier: Fisher BioReagents FLBP220 212
| Quantity | 2.5 kg |
|---|---|
| Packaging | Glass Bottle |
Description
D-Sucrose is suitable for the preparation of density gradients used in purification of proteins and nucleic acids by ultracentrifugation.Chemical Identifiers
| 57-50-1 | |
| 342.30 | |
| CZMRCDWAGMRECN-PWPRYFECNA-N | |
| 5988 | |
| (2R,3R,4S,5S,6R)-2-[(2S,3S,4S,5R)-3,4-dihydroxy-2,5-bis(hydroxymethyl)oxolan-2-yl]oxy-6-(hydroxymethyl)oxane-3,4,5-triol |
| C12H22O11 | |
| MFCD00006626 | |
| sucrose, saccharose, cane sugar, sugar, table sugar, white sugar, d-sucrose, saccharum, rohrzucker, amerfand | |
| CHEBI:17992 | |
| OC[C@H]1O[C@@](CO)(O[C@H]2O[C@H](CO)[C@@H](O)[C@H](O)[C@H]2O)[C@@H](O)[C@@H]1O |
Specifications
| D-Sucrose | |
| 57-50-1 | |
| White | |
| 0.01% max. | |
| DNase-, RNase- and Protease-Free | |
| Glass Bottle | |
| MFCD00006626 | |
| 15, 9012 | |
| sucrose, saccharose, cane sugar, sugar, table sugar, white sugar, d-sucrose, saccharum, rohrzucker, amerfand | |
| CZMRCDWAGMRECN-PWPRYFECNA-N | |
| (2R,3R,4S,5S,6R)-2-[(2S,3S,4S,5R)-3,4-dihydroxy-2,5-bis(hydroxymethyl)oxolan-2-yl]oxy-6-(hydroxymethyl)oxane-3,4,5-triol | |
| 5988 | |
| 342.29 | |
| Molecular Biology |
| Sucrose | |
| 190°C | |
| 6.5 to 7.5 | |
| 0.03% max. | |
| ≥99.9% | |
| C12H22O11 | |
| 2.5 kg | |
| +66 to +67° (+ or -) | |
| 0.005% max. Insoluble Matter | |
| OC[C@H]1O[C@@](CO)(O[C@H]2O[C@H](CO)[C@@H](O)[C@H](O)[C@H]2O)[C@@H](O)[C@@H]1O | |
| 342.30 | |
| CHEBI:17992 | |
| ≥99.9% | |
| Solid |
Safety and Handling
CAUTION!
Emergency Overview
May cause skin, eye, and respiratory tract irritation. Wear personal protective equipment. Ensure adequate ventilation. Avoid contact with skin, eyes and clothing. Avoid ingestion and inhalation. Use personal protective equipment. Wash off immediately with plenty of water for at least 15 minutes. Get medical attention immediately if symptoms occur. Rinse immediately with plenty of water, also under the eyelids, for at least 15 minutes. Obtain medical attention. Move to fresh air. If breathing is difficult, give oxygen. If breathing is difficult, give oxygen. Get medical attention immediately if symptoms occur.
NFPA
Health:1
Flammability:1
Instability:0
Recommended Storage : RT