Learn More
Cyclophosphamide monohydrate, 97%
CAS: 6055-19-2 | C7H17Cl2N2O3P | 279.10 g/mol
$121.08 - $389.12
Chemical Identifiers
| CAS | 6055-19-2 |
|---|---|
| Molecular Formula | C7H17Cl2N2O3P |
| Molecular Weight (g/mol) | 279.10 |
| MDL Number | MFCD00149395 |
| InChI Key | PWOQRKCAHTVFLB-UHFFFAOYNA-N |
| Synonym | cyclophosphamide monohydrate, cyclophosphamide hydrate, cytoxan, endoxon, endoxan monohydrate, ciclophosphamide hydrat, cytoxan hydrate, endoxan a, cyclophosphamide hydrated |
| PubChem CID | 22420 |
| ChEBI | CHEBI:4026 |
| IUPAC Name | N,N-bis(2-chloroethyl)-2-oxo-1,3,2$l^{5}-oxazaphosphinan-2-amine;hydrate |
| SMILES | O.ClCCN(CCCl)P1(=O)NCCCO1 |
| Catalog Number | Mfr. No. | Quantity | Packaging | Price | Quantity | ||||
|---|---|---|---|---|---|---|---|---|---|
| Catalog Number | Mfr. No. | Quantity | Packaging | Price | Quantity | ||||
|
AC203960010
|
Thermo Scientific Chemicals
203960010 |
1 g | Glass bottle |
Each for $121.08
|
|
||||
|
AC203960050
|
Thermo Scientific Chemicals
203960050 |
5 g | Glass bottle |
Each for $389.12
|
|
||||
Description
This Thermo Scientific Chemicals brand product was originally part of the Acros Organics product portfolio. Some documentation and label information may refer to the legacy brand. The original Acros Organics product / item code or SKU reference has not changed as a part of the brand transition to Thermo Scientific Chemicals.
Chemical Identifiers
| 6055-19-2 | |
| 279.10 | |
| PWOQRKCAHTVFLB-UHFFFAOYNA-N | |
| 22420 | |
| N,N-bis(2-chloroethyl)-2-oxo-1,3,2$l^{5}-oxazaphosphinan-2-amine;hydrate |
| C7H17Cl2N2O3P | |
| MFCD00149395 | |
| cyclophosphamide monohydrate, cyclophosphamide hydrate, cytoxan, endoxon, endoxan monohydrate, ciclophosphamide hydrat, cytoxan hydrate, endoxan a, cyclophosphamide hydrated | |
| CHEBI:4026 | |
| O.ClCCN(CCCl)P1(=O)NCCCO1 |
Specifications
| 6055-19-2 | |
| White | |
| Authentic | |
| Glass bottle | |
| MFCD00149395 | |
| 15, 2743 | |
| Solubility in water: 40g/L. Other solubilities: slightly soluble in alcohol,benzene,ethylene,glycol,carbon tetrachloride and dioxane,sparingly soluble in ether and acetone | |
| O.ClCCN(CCCl)P1(=O)NCCCO1 | |
| 279.10 | |
| CHEBI:4026 | |
| 97% | |
| Cyclophosphamide monohydrate |
| 49.0°C to 53.0°C | |
| >110°C | |
| 96% min. (ELSD) (HPLC) | |
| C7H17Cl2N2O3P | |
| 1 g | |
| cyclophosphamide monohydrate, cyclophosphamide hydrate, cytoxan, endoxon, endoxan monohydrate, ciclophosphamide hydrat, cytoxan hydrate, endoxan a, cyclophosphamide hydrated | |
| PWOQRKCAHTVFLB-UHFFFAOYNA-N | |
| N,N-bis(2-chloroethyl)-2-oxo-1,3,2$l^{5}-oxazaphosphinan-2-amine;hydrate | |
| 22420 | |
| 279.09 | |
| Crystalline Powder or Crystals |
Safety and Handling
GHS H Statement
May cause genetic defects.
May cause cancer.
May damage the unborn child.
Toxic if swallowed.
GHS P Statement
IF SWALLOWED: Immediately call a POISON CENTER or doctor/physician.
Obtain special instructions before use.
IF exposed or concerned: Get medical advice/attention.
Wash face,hands and any exposed skin thoroughly after
GHS Signal Word: Danger
RUO – Research Use Only