missing translation for 'onlineSavingsMsg'
Learn More
Learn More
Cephalexin Monohydrate USP MP Biomedicals
Supplier: MP Biomedicals Inc 0215058505
Specifications
| Cephalexin Monohydrate | |
| Crystalline Powder | |
| Beige to White | |
| ≥95% | |
| MFCD00167148,MFCD00056877 | |
| AVGYWQBCYZHHPN-CYJZLJNKSA-N | |
| (6R,7R)-7-[(2R)-2-amino-2-phenylacetamido]-3-methyl-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylic acid hydrate | |
| 62921 | |
| 365.4 |
| Cephalexin Monohydrate | |
| 23325-78-2 | |
| 5 g | |
| C16H19N3O5S | |
| 7-(d-a-Aminophenylacetamido)desacetoxycephalosporanic acid, Cefalexin monohydrate | |
| O.CC1=C(N2[C@H](SC1)[C@H](NC(=O)[C@H](N)C1=CC=CC=C1)C2=O)C(O)=O | |
| 365.40 | |
| CHEBI:3535 | |
| BP/USP |
Chemical Identifiers
| 23325-78-2 | |
| 365.40 | |
| AVGYWQBCYZHHPN-CYJZLJNKSA-N | |
| 62921 | |
| (6R,7R)-7-[(2R)-2-amino-2-phenylacetamido]-3-methyl-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylic acid hydrate |
| C16H19N3O5S | |
| MFCD00167148,MFCD00056877 | |
| 7-(d-a-Aminophenylacetamido)desacetoxycephalosporanic acid, Cefalexin monohydrate | |
| CHEBI:3535 | |
| O.CC1=C(N2[C@H](SC1)[C@H](NC(=O)[C@H](N)C1=CC=CC=C1)C2=O)C(O)=O |
Safety and Handling
EINECSNumber : 239-773-6
Recommended Storage : Store at 4°C, desiccate.