missing translation for 'onlineSavingsMsg'
Learn More
Learn More
Cabozantinib (S)-malate, Thermo Scientific™
Supplier: Thermo Scientific Chemicals 468902500
Specifications
| Cabozantinib (S)-malate | |
| Available | |
| Crystalline Powder | |
| MFCD20923480 | |
| 166°C to 172°C | |
| OC(CC(O)=O)C(O)=O.COC1=C(OC)C=C2C(OC3=CC=C(NC(=O)C4(CC4)C(=O)NC4=CC=C(F)C=C4)C=C3)=CC=NC2=C1 | |
| 635.60 |
| Glass Bottle | |
| 1140909-48-3 | |
| C32H30FN3O10 | |
| White to Light Beige | |
| HFCFMRYTXDINDK-UHFFFAOYNA-N | |
| 2-hydroxybutanedioic acid; N'1-{4-[(6,7-dimethoxyquinolin-4-yl)oxy]phenyl}-N1-(4-fluorophenyl)cyclopropane-1,1-dicarboxamide | |
| 250 mg |
Chemical Identifiers
| 1140909-48-3 | |
| 635.60 | |
| HFCFMRYTXDINDK-UHFFFAOYNA-N | |
| OC(CC(O)=O)C(O)=O.COC1=C(OC)C=C2C(OC3=CC=C(NC(=O)C4(CC4)C(=O)NC4=CC=C(F)C=C4)C=C3)=CC=NC2=C1 |
| C32H30FN3O10 | |
| MFCD20923480 | |
| 2-hydroxybutanedioic acid; N'1-{4-[(6,7-dimethoxyquinolin-4-yl)oxy]phenyl}-N1-(4-fluorophenyl)cyclopropane-1,1-dicarboxamide |
Safety and Handling
Health hazard
Exclamation mark
Recommended Storage : Normal conditions