missing translation for 'onlineSavingsMsg'
Learn More
Learn More
Bromothymol Blue, 0.04% Aqueous, pH 6.0 to 7.6 Yellow to Blue, Certified, LabChem™
$39.18 - $131.50
Chemical Identifiers
| CAS | 34722-90-2 , 7732-18-5 |
|---|---|
| Molecular Formula | C27H27Br2NaO5S |
| Molecular Weight (g/mol) | 646.37 |
| MDL Number | MFCD00077263,MFCD00077263,MFCD00077263 |
| InChI Key | NMKFVGALBGZKGW-FKWCIMQXSA-M |
| PubChem CID | 102183223 |
| IUPAC Name | sodium 2-{[(1Z)-3-bromo-2-methyl-4-oxo-5-(propan-2-yl)cyclohexa-2,5-dien-1-ylidene][3-bromo-4-hydroxy-2-methyl-5-(propan-2-yl)phenyl]methyl}benzene-1-sulfonate |
| SMILES | [Na+].CC(C)C1=CC(\C(C2=CC=CC=C2S([O-])(=O)=O)=C2/C=C(C(C)C)C(=O)C(Br)=C2C)=C(C)C(Br)=C1O |
Chemical Identifiers
| 34722-90-2 , 7732-18-5 | |
| 646.37 | |
| NMKFVGALBGZKGW-FKWCIMQXSA-M | |
| sodium 2-{[(1Z)-3-bromo-2-methyl-4-oxo-5-(propan-2-yl)cyclohexa-2,5-dien-1-ylidene][3-bromo-4-hydroxy-2-methyl-5-(propan-2-yl)phenyl]methyl}benzene-1-sulfonate |
| C27H27Br2NaO5S | |
| MFCD00077263,MFCD00077263,MFCD00077263 | |
| 102183223 | |
| [Na+].CC(C)C1=CC(\C(C2=CC=CC=C2S([O-])(=O)=O)=C2/C=C(C(C)C)C(=O)C(Br)=C2C)=C(C)C(Br)=C1O |
Specifications
| 34722-90-2 , 7732-18-5 | |
| C27H27Br2NaO5S | |
| MFCD00077263,MFCD00077263,MFCD00077263 | |
| Passes Test | |
| [Na+].CC(C)C1=CC(\C(C2=CC=CC=C2S([O-])(=O)=O)=C2/C=C(C(C)C)C(=O)C(Br)=C2C)=C(C)C(Br)=C1O | |
| 646.37 | |
| 646.37 | |
| 1g/mL | |
| 1g/mL | |
| Liquid |
| 99.96, 0.04 | |
| C27H27Br2O5S·Na | |
| Soluble in water | |
| NMKFVGALBGZKGW-FKWCIMQXSA-M | |
| sodium 2-{[(1Z)-3-bromo-2-methyl-4-oxo-5-(propan-2-yl)cyclohexa-2,5-dien-1-ylidene][3-bromo-4-hydroxy-2-methyl-5-(propan-2-yl)phenyl]methyl}benzene-1-sulfonate | |
| 102183223 | |
| Certified | |
| Nitrogen oxides; Carbon monoxide; Carbon dioxide | |
| Green | |
| Bromothymol Blue, 0.04% Aqueous, pH 6.0 to 7.6 Yellow to Blue |
Safety and Handling
GHS H Statement
Solution is not hazardous.
GHS P Statement
If in contact with skin or eyes, rinse thoroughly with water for 15-20 minutes.
If swallowed, get medical attention.
Recommended Storage : Room Temperature