Learn More
Bis(2-ethylhexyl) phosphate, 95%
Extraction of metals | CAS: 298-07-7 | C16H35O4P | 322.43 g/mol
$73.10 - $737.90
Chemical Identifiers
| CAS | 298-07-7 |
|---|---|
| Molecular Formula | C16H35O4P |
| Molecular Weight (g/mol) | 322.43 |
| MDL Number | MFCD00009492 |
| InChI Key | SEGLCEQVOFDUPX-UHFFFAOYNA-N |
| Synonym | bis 2-ethylhexyl hydrogen phosphate, bis 2-ethylhexyl phosphate, hdehp, di 2-ethylhexyl phosphate, dehpa extractant, di 2-ethylhexyl phosphoric acid, escaid 100, d 2ehpa, bis 2-ethylhexyl phosphoric acid |
| PubChem CID | 9275 |
| IUPAC Name | bis(2-ethylhexyl) hydrogen phosphate |
| SMILES | CCCCC(CC)COP(O)(=O)OCC(CC)CCCC |
| Catalog Number | Mfr. No. | Quantity | Price | Quantity | |||||
|---|---|---|---|---|---|---|---|---|---|
| Catalog Number | Mfr. No. | Quantity | Price | Quantity | |||||
|
AA1772322
|
Thermo Scientific Chemicals
1772322 |
100 g |
Each for $73.10
|
|
|||||
|
AA1772336
|
Thermo Scientific Chemicals
01772336 |
500 g |
Each for $227.73
|
|
|||||
|
AA17723A3
|
Thermo Scientific Chemicals
017723A3 |
2 kg |
Each for $737.90
|
|
|||||
Description
Extraction of metals.Bis(2-ethylhexyl) phosphate is used as a lubricant additive, corrosion inhibitor and a metal extractant. It is involved in the solvent extraction of uranium salts and rare earth metals. Iron(II) ions are extracted after reduction of Iron(III) ions. Further, it is used as a plasticizer and as a solvent in the synthesis of plastic.
This Thermo Scientific Chemicals brand product was originally part of the Alfa Aesar product portfolio. Some documentation and label information may refer to the legacy brand. The original Alfa Aesar product / item code or SKU reference has not changed as a part of the brand transition to Thermo Scientific Chemicals.
Chemical Identifiers
| 298-07-7 | |
| 322.43 | |
| SEGLCEQVOFDUPX-UHFFFAOYNA-N | |
| 9275 | |
| CCCCC(CC)COP(O)(=O)OCC(CC)CCCC |
| C16H35O4P | |
| MFCD00009492 | |
| bis 2-ethylhexyl hydrogen phosphate, bis 2-ethylhexyl phosphate, hdehp, di 2-ethylhexyl phosphate, dehpa extractant, di 2-ethylhexyl phosphoric acid, escaid 100, d 2ehpa, bis 2-ethylhexyl phosphoric acid | |
| bis(2-ethylhexyl) hydrogen phosphate |
Specifications
| 298-07-7 | |
| Colorless | |
| 2 to 3 | |
| 171°C (340°F) | |
| C16H35O4P | |
| MFCD00009492 | |
| UN1902 | |
| Slightly miscible with water. | |
| CCCCC(CC)COP(O)(=O)OCC(CC)CCCC | |
| 322.43 | |
| 322.43 | |
| Liquid |
| -50°C | |
| 0.965 g/mL | |
| 48°C (12 mmHg) | |
| 95% | |
| 1.442 | |
| 100 g | |
| bis 2-ethylhexyl hydrogen phosphate, bis 2-ethylhexyl phosphate, hdehp, di 2-ethylhexyl phosphate, dehpa extractant, di 2-ethylhexyl phosphoric acid, escaid 100, d 2ehpa, bis 2-ethylhexyl phosphoric acid | |
| SEGLCEQVOFDUPX-UHFFFAOYNA-N | |
| bis(2-ethylhexyl) hydrogen phosphate | |
| 9275 | |
| 95% | |
| Bis(2-ethylhexyl) phosphate |
Safety and Handling
GHS H Statement
H314-H318-H312
Causes severe skin burns and eye damage.
Causes serious eye damage.
Harmful in contact with skin.
P260-P264b-P270-P271-P280-P303+P361+P353-P304+P340-P305+P351+P338-P310-P330-P331-P363-P501c
H302-H314-H335
DOTInformation : Transport Hazard Class: 8; Packing Group: III; Proper Shipping Name: DIISOOCTYL ACID PHOSPHATE
EINECSNumber : 206-056-4
RTECSNumber : TB7875000
TSCA : Yes
Recommended Storage : Ambient temperatures
RUO – Research Use Only