missing translation for 'onlineSavingsMsg'
Learn More
Learn More
Bicine, 99+%, for analysis
CAS: 150-25-4 | C6H12NNaO4 | 185.16 g/mol
Supplier: Thermo Scientific Chemicals 172652500
Description
This Thermo Scientific Chemicals brand product was originally part of the Acros Organics product portfolio. Some documentation and label information may refer to the legacy brand. The original Acros Organics product / item code or SKU reference has not changed as a part of the brand transition to Thermo Scientific Chemicals.
Biological bufferSpecifications
| 0.05 max. (5% aqueous soln.) at 250nm | |
| 99+% | |
| 150-25-4 | |
| 100.0 | |
| 4.0 to 5.5 (10% soln. at 20°C) | |
| 250 g | |
| Authentic | |
| (HOCH2CH2)2NCH2CO2H | |
| Glass bottle | |
| N, N-Bis(2-hydroxyethyl)glycine, Diethylolglycine | |
| [Na+].OCCN(CCO)CC([O-])=O | |
| 185.16 | |
| CHEBI:40957 | |
| ≥99.0% (Total base) |
| Bicine | |
| (5% aq. soln.) (1cm cell) | |
| 99.0 | |
| White | |
| Crystalline Powder | |
| 99+% | |
| C6H12NNaO4 | |
| MFCD00004295 | |
| 15, 1205 | |
| MFBDBXAVPLFMNJ-UHFFFAOYSA-M | |
| 2-[bis(2-hydroxyethyl)amino]acetic acid | |
| 8761 | |
| 163.17 | |
| Analytical |
Chemical Identifiers
| 150-25-4 | |
| 185.16 | |
| MFBDBXAVPLFMNJ-UHFFFAOYSA-M | |
| 8761 | |
| 2-[bis(2-hydroxyethyl)amino]acetic acid |
| C6H12NNaO4 | |
| MFCD00004295 | |
| N, N-Bis(2-hydroxyethyl)glycine, Diethylolglycine | |
| CHEBI:40957 | |
| [Na+].OCCN(CCO)CC([O-])=O |
Safety and Handling
EINECSNumber : 205-755-1
RTECSNumber : MB9700000
TSCA : TSCA
RUO – Research Use Only