Learn More
Benzyltrimethylammonium chloride, 50 wt% solution in water
CAS: 56-93-9 | C10H16ClN | 185.70 g/mol
$52.92 - $218.06
Chemical Identifiers
| CAS | 56-93-9 |
|---|---|
| Molecular Formula | C10H16ClN |
| Molecular Weight (g/mol) | 185.70 |
| MDL Number | MFCD00011782 |
| InChI Key | KXHPPCXNWTUNSB-UHFFFAOYSA-M |
| Synonym | benzyltrimethylammonium chloride, tmbac, benzyl trimethylammonium chloride, benzyltrimethyl ammonium chloride, benzyl trimethyl ammonium chloride, benzenemethanaminium, n,n,n-trimethyl-, chloride, benzyltrimethylazanium chloride, unii-vnk45y7ba1, ammonium, benzyltrimethyl-, chloride, trimethylbenzylammonium chloride |
| PubChem CID | 5963 |
| IUPAC Name | benzyl(trimethyl)azanium;chloride |
| SMILES | [Cl-].C[N+](C)(C)CC1=CC=CC=C1 |
| Catalog Number | Mfr. No. | Quantity | Packaging | Price | Quantity | ||||
|---|---|---|---|---|---|---|---|---|---|
| Catalog Number | Mfr. No. | Quantity | Packaging | Price | Quantity | ||||
|
AC209381000
|
Thermo Scientific Chemicals
209381000 |
100 g | Glass bottle |
Each for $52.92
|
|
||||
|
AC209380010
|
Thermo Scientific Chemicals
209380010 |
1 kg | Glass bottle |
Each for $218.06
|
|
||||
Description
This Thermo Scientific Chemicals brand product was originally part of the Acros Organics product portfolio. Some documentation and label information may refer to the legacy brand. The original Acros Organics product / item code or SKU reference has not changed as a part of the brand transition to Thermo Scientific Chemicals.
Phase transfer catalystChemical Identifiers
| 56-93-9 | |
| 185.70 | |
| KXHPPCXNWTUNSB-UHFFFAOYSA-M | |
| 5963 | |
| [Cl-].C[N+](C)(C)CC1=CC=CC=C1 |
| C10H16ClN | |
| MFCD00011782 | |
| benzyltrimethylammonium chloride, tmbac, benzyl trimethylammonium chloride, benzyltrimethyl ammonium chloride, benzyl trimethyl ammonium chloride, benzenemethanaminium, n,n,n-trimethyl-, chloride, benzyltrimethylazanium chloride, unii-vnk45y7ba1, ammonium, benzyltrimethyl-, chloride, trimethylbenzylammonium chloride | |
| benzyl(trimethyl)azanium;chloride |
Specifications
| Colorless to Yellow | |
| 49.0,49.0 | |
| C10H16ClN | |
| MFCD00011782 | |
| 01,53 | |
| benzyltrimethylammonium chloride, tmbac, benzyl trimethylammonium chloride, benzyltrimethyl ammonium chloride, benzyl trimethyl ammonium chloride, benzenemethanaminium, n,n,n-trimethyl-, chloride, benzyltrimethylazanium chloride, unii-vnk45y7ba1, ammonium, benzyltrimethyl-, chloride, trimethylbenzylammonium chloride | |
| [Cl-].C[N+](C)(C)CC1=CC=CC=C1 | |
| 185.70 | |
| 185.7 | |
| Glass bottle | |
| 1.044 | |
| Liquid |
| 56-93-9,7732-18-5 | |
| 51.0,51.0 | |
| C6H5CH2N(CH3)3Cl | |
| 12, 1020 | |
| 1.0440g/mL | |
| KXHPPCXNWTUNSB-UHFFFAOYSA-M | |
| benzyl(trimethyl)azanium;chloride | |
| 5963 | |
| ≥49% | |
| 1.445 | |
| 100 g | |
| Benzyltrimethylammonium chloride, 50 wt. % Solution in Water |
Safety and Handling
GHS P Statement Toxic if swallowed. Toxic in contact with skin. Harmful if inhaled. Suspected of causing genetic defects. Harmful to aquatic life with long lasting effects.
GHS P Statement Wear protective gloves/protective clothing/eye protection/face protection. IF exposed: Call a POISON CENTRE or doctor/physician. Avoid release to the environment.
Danger
EINECSNumber : 200-300-3
RTECSNumber : BO8400000
TSCA : TSCA
RUO – Research Use Only