Learn More
Benzyltrimethylammonium chloride, 50 wt% solution in water
CAS: 56-93-9 | C10H16ClN | 185.70 g/mol
Supplier: Thermo Scientific Chemicals 209380010
Description
This Thermo Scientific Chemicals brand product was originally part of the Acros Organics product portfolio. Some documentation and label information may refer to the legacy brand. The original Acros Organics product / item code or SKU reference has not changed as a part of the brand transition to Thermo Scientific Chemicals.
Phase transfer catalystSpecifications
| Benzyltrimethylammonium chloride | |
| 50 wt. % Solution in Water | |
| 49.0,49.0 | |
| C10H16ClN | |
| MFCD00011782 | |
| 01,53 | |
| benzyltrimethylammonium chloride, tmbac, benzyl trimethylammonium chloride, benzyltrimethyl ammonium chloride, benzyl trimethyl ammonium chloride, benzenemethanaminium, n,n,n-trimethyl-, chloride, benzyltrimethylazanium chloride, unii-vnk45y7ba1, ammonium, benzyltrimethyl-, chloride, trimethylbenzylammonium chloride | |
| [Cl-].C[N+](C)(C)CC1=CC=CC=C1 | |
| 185.70 | |
| 185.7 | |
| Glass bottle | |
| 1.044 | |
| Liquid |
| Colorless to Yellow | |
| 56-93-9,7732-18-5 | |
| 51.0,51.0 | |
| C6H5CH2N(CH3)3Cl | |
| 12, 1020 | |
| 1.0440g/mL | |
| KXHPPCXNWTUNSB-UHFFFAOYSA-M | |
| benzyl(trimethyl)azanium;chloride | |
| 5963 | |
| ≥49% | |
| 1.445 | |
| 1 kg |
Chemical Identifiers
| 56-93-9 | |
| 185.70 | |
| KXHPPCXNWTUNSB-UHFFFAOYSA-M | |
| 5963 | |
| [Cl-].C[N+](C)(C)CC1=CC=CC=C1 |
| C10H16ClN | |
| MFCD00011782 | |
| benzyltrimethylammonium chloride, tmbac, benzyl trimethylammonium chloride, benzyltrimethyl ammonium chloride, benzyl trimethyl ammonium chloride, benzenemethanaminium, n,n,n-trimethyl-, chloride, benzyltrimethylazanium chloride, unii-vnk45y7ba1, ammonium, benzyltrimethyl-, chloride, trimethylbenzylammonium chloride | |
| benzyl(trimethyl)azanium;chloride |
Safety and Handling
GHS P Statement Toxic if swallowed. Toxic in contact with skin. Harmful if inhaled. Suspected of causing genetic defects. Harmful to aquatic life with long lasting effects.
GHS P Statement Wear protective gloves/protective clothing/eye protection/face protection. IF exposed: Call a POISON CENTRE or doctor/physician. Avoid release to the environment.
Danger
EINECSNumber : 200-300-3
RTECSNumber : BO8400000
TSCA : TSCA
RUO – Research Use Only