Learn More
Benzoyl Peroxide (Wet/Certified),75%(weight), 25% water, Fisher Chemical™
Supplier: Thermo Fisher Scientific FLB2741LB
Specifications
| Benzoyl Peroxide (Wet) | |
| 104°C | |
| 103°C min. to 106°C max. | |
| C14H10O4 | |
| MFCD00003071 | |
| benzoyl peroxide, dibenzoyl peroxide, peroxide, dibenzoyl, benzoperoxide, benzoyl superoxide, acetoxyl, lucidol, benoxyl, panoxyl, benzol peroxide | |
| C1=CC=C(C=C1)C(=O)OOC(=O)C2=CC=CC=C2 | |
| 242.23 | |
| CHEBI:82405 | |
| Certified | |
| Solid |
| 94-36-0 , 7732-18-5 | |
| White | |
| Poly Bottle | |
| (C6H5C(O))-O-O-(C(O)C6H5) | |
| 1 lb. | |
| OMPJBNCRMGITSC-UHFFFAOYSA-N | |
| benzoyl benzenecarboperoxoate | |
| 7187 | |
| 242.23 | |
| Benzoyl peroxide 75%, Water 25% |
Chemical Identifiers
| 94-36-0 | |
| 242.23 | |
| OMPJBNCRMGITSC-UHFFFAOYSA-N | |
| 7187 | |
| benzoyl benzenecarboperoxoate |
| C14H10O4 | |
| MFCD00003071 | |
| benzoyl peroxide, dibenzoyl peroxide, peroxide, dibenzoyl, benzoperoxide, benzoyl superoxide, acetoxyl, lucidol, benoxyl, panoxyl, benzol peroxide | |
| CHEBI:82405 | |
| C1=CC=C(C=C1)C(=O)OOC(=O)C2=CC=CC=C2 |
Safety and Handling
DANGER!
Emergency Overview
Explosive when dry. Oxidizer: Contact with combustible/organic material may cause fire. Organic peroxide May undergo hazardous decomposition. Irritating to eyes, respiratory system and skin. Wear personal protective equipment. Keep away from clothing and other combustible materials. Use only under a chemical fume hood. Wash off immediately with plenty of water for at least 15 minutes. Obtain medical attention. Rinse immediately with plenty of water, also under the eyelids, for at least 15 minutes. Obtain medical attention. Move to fresh air. Move to fresh air. If breathing is difficult, give oxygen.
NFPA
Health:1
Flammability:3
Instability:4