missing translation for 'onlineSavingsMsg'
Learn More
Learn More
Acipimox, Thermo Scientific™
$125.77 - $350.03
| Catalog Number | Mfr. No. | Quantity | Price | Quantity | |||||
|---|---|---|---|---|---|---|---|---|---|
| Catalog Number | Mfr. No. | Quantity | Price | Quantity | |||||
|
AC466990010
|
Thermo Scientific Chemicals
466990010 |
1 g |
Each for $125.77
|
|
|||||
|
AC466990050
|
Thermo Scientific Chemicals
466990050 |
5 g |
Each for $350.03
|
|
|||||
Chemical Identifiers
| 51037-30-0 | |
| C6 H6 N2 O3 |
Specifications
| 51037-30-0 | |
| Soluble in methanol | |
| 180°C to 190°C | |
| 154.12 | |
| White to Almost-white | |
| DNRXJHATQULEHC-UHFFFAOYSA-N | |
| 2-carboxy-6-methylpyrazin-1-ium-1-olate | |
| Acipimox |
| 1 g | |
| 13-113 | |
| C6 H6 N2 O3 | |
| Powder | |
| ≥98.0% | |
| CC1=CN=CC(C(O)=O)=[N+]1[O-] | |
| 154.13 |
Safety and Handling
Exclamation mark
EINECSNumber : 256-928-3
Recommended Storage : Normal conditions