Learn More
Thermo Scientific Chemicals (+)-5-Fluoro-2'-deoxyuridine, 99+%
CAS: 50-91-9 | C9H11FN2O5 | 246.19 g/mol
$424.78 - $2384.28
Chemical Identifiers
| CAS | 50-91-9 |
|---|---|
| Molecular Formula | C9H11FN2O5 |
| Molecular Weight (g/mol) | 246.19 |
| MDL Number | MFCD00006530 |
| InChI Key | ODKNJVUHOIMIIZ-RRKCRQDMSA-N |
| Synonym | floxuridine, 2'-deoxy-5-fluorouridine, 5-fluoro-2'-deoxyuridine, 5-fluorodeoxyuridine, fluorodeoxyuridine, floxuridin, fudr, deoxyfluorouridine, fluoruridine deoxyribose, fdurd |
| PubChem CID | 5790 |
| ChEBI | CHEBI:60761 |
| IUPAC Name | 5-fluoro-1-[(2R,4S,5R)-4-hydroxy-5-(hydroxymethyl)oxolan-2-yl]pyrimidine-2,4-dione |
| SMILES | OC[C@H]1O[C@H](C[C@@H]1O)N1C=C(F)C(=O)NC1=O |
| Catalog Number | Mfr. No. | Quantity | Packaging | Price | Quantity | ||||
|---|---|---|---|---|---|---|---|---|---|
| Catalog Number | Mfr. No. | Quantity | Packaging | Price | Quantity | ||||
|
AC227601000
|
Thermo Scientific Chemicals
227601000 |
100 mg | Glass bottle |
Each for $424.78
|
|
||||
|
AC227600025
|
Thermo Scientific Chemicals
227600025 |
2.5 g | Glass bottle |
Each for $2,384.28
|
|
||||
Description
This Thermo Scientific Chemicals brand product was originally part of the Acros Organics product portfolio. Some documentation and label information may refer to the legacy brand. The original Acros Organics product / item code or SKU reference has not changed as a part of the brand transition to Thermo Scientific Chemicals.
Chemical Identifiers
| 50-91-9 | |
| 246.19 | |
| ODKNJVUHOIMIIZ-RRKCRQDMSA-N | |
| 5790 | |
| 5-fluoro-1-[(2R,4S,5R)-4-hydroxy-5-(hydroxymethyl)oxolan-2-yl]pyrimidine-2,4-dione |
| C9H11FN2O5 | |
| MFCD00006530 | |
| floxuridine, 2'-deoxy-5-fluorouridine, 5-fluoro-2'-deoxyuridine, 5-fluorodeoxyuridine, fluorodeoxyuridine, floxuridin, fudr, deoxyfluorouridine, fluoruridine deoxyribose, fdurd | |
| CHEBI:60761 | |
| OC[C@H]1O[C@H](C[C@@H]1O)N1C=C(F)C(=O)NC1=O |
Specifications
| 50-91-9 | |
| White | |
| Authentic | |
| Glass bottle | |
| MFCD00006530 | |
| 15,4144 | |
| + 35.90 | |
| Solubility in water: soluble. Other solubilities: soluble in alcohol,practically insoluble in chcl3,insoluble in ether and hexane | |
| OC[C@H]1O[C@H](C[C@@H]1O)N1C=C(F)C(=O)NC1=O | |
| 246.19 | |
| CHEBI:60761 | |
| 99+% | |
| (+)-5-Fluoro-2′-deoxyuridine |
| 148.0°C to 153.0°C | |
| 0.5% (60°C, 4 hrs) (vacuum) max. | |
| 99% min. (HPLC) | |
| C9H11FN2O5 | |
| 100 mg | |
| + 35.90 (20.00°C c=1,water) | |
| floxuridine, 2'-deoxy-5-fluorouridine, 5-fluoro-2'-deoxyuridine, 5-fluorodeoxyuridine, fluorodeoxyuridine, floxuridin, fudr, deoxyfluorouridine, fluoruridine deoxyribose, fdurd | |
| ODKNJVUHOIMIIZ-RRKCRQDMSA-N | |
| 5-fluoro-1-[(2R,4S,5R)-4-hydroxy-5-(hydroxymethyl)oxolan-2-yl]pyrimidine-2,4-dione | |
| 5790 | |
| 246.19 | |
| Powder |
Safety and Handling
GHS H Statement
Toxic if swallowed.
Causes skin irritation.
Causes serious eye irritation.
Suspected of causing genetic defects.
GHS P Statement
Immediately call a POISON CENTER or doctor/physician.
Use personal protective equipment as required.
Do not handle until all safety precautions have been read and understood.
IF ON SKIN: Wash with plenty of soap and
GHS Signal Word: Danger
EINECSNumber : 200-072-5
RUO – Research Use Only