Learn More
4-Nitrophenylboronic acid, 97%, Thermo Scientific™
Supplier: Thermo Scientific Chemicals 433890010
| Quantity | 1g |
|---|---|
| Packaging | Glass bottle |
Description
This Thermo Scientific brand product was originally part of the Acros Organics product portfolio. Some documentation and label information may refer to the legacy brand. The original Acros Organics product / item code or SKU reference has not changed as a part of the brand transition to Thermo Scientific.
Chemical Identifiers
| 24067-17-2 | |
| 166.93 | |
| NSFJAFZHYOAMHL-UHFFFAOYSA-N | |
| 2773552 | |
| B(C1=CC=C(C=C1)[N+](=O)[O-])(O)O |
| C6H6BNO4 | |
| MFCD00161360 | |
| 4-nitrophenyl boronic acid, 4-nitrobenzeneboronic acid, p-nitrophenylboronic acid, 4-nitrophenylboronicacid, p-nitrophenyl boronic acid, 4-nitro phenyl boronic acid, boronic acid, 4-nitrophenyl, boronic acid, b-4-nitrophenyl, 4-borononitrobenzene | |
| (4-nitrophenyl)boronic acid |
Specifications
| 4-Nitrophenylboronic acid | |
| 96.0 | |
| Authentic | |
| Glass bottle | |
| 1g | |
| 4-nitrophenyl boronic acid, 4-nitrobenzeneboronic acid, p-nitrophenylboronic acid, 4-nitrophenylboronicacid, p-nitrophenyl boronic acid, 4-nitro phenyl boronic acid, boronic acid, 4-nitrophenyl, boronic acid, b-4-nitrophenyl, 4-borononitrobenzene | |
| B(C1=CC=C(C=C1)[N+](=O)[O-])(O)O | |
| 166.93 | |
| 166.93 |
| 24067-17-2 | |
| 100.0 | |
| 96% min. (HPLC) | |
| C6H6BNO4 | |
| MFCD00161360 | |
| NSFJAFZHYOAMHL-UHFFFAOYSA-N | |
| (4-nitrophenyl)boronic acid | |
| 2773552 | |
| 97% |
Safety and Handling
GHS H Statement
Causes skin irritation.
Causes serious eye irritation.
May cause respiratory irritation.
GHS P Statement
Wear protective gloves/protective clothing/eye protection/face protection.
Call a POISON CENTER or doctor/physician if you feel unwell.
IF ON SKIN: Wash with plenty of soap and water.
IF INHALED: Remove to fresh air
GHS Signal Word: Warning