missing translation for 'onlineSavingsMsg'
Learn More
Learn More
2-Phenyl-5-oxazolone, 97%
CAS: 1199-01-5 | C9H7NO2 | 161.16 g/mol
$124.92 - $1412.04
Chemical Identifiers
| CAS | 1199-01-5 |
|---|---|
| Molecular Formula | C9H7NO2 |
| Molecular Weight (g/mol) | 161.16 |
| MDL Number | MFCD00014517 |
| InChI Key | QKCKCXFWENOGER-UHFFFAOYSA-N |
| Synonym | 2-phenyloxazol-5 4h-one, phenyloxazolone, 2-phenyl-5-oxazolone, 2-phenyloxazolone, 2-phenyloxazolin-5-one, 5 4h-oxazolone, 2-phenyl, 2-phenyl-5 4h-oxazolone, 2-phenyl-1,3-oxazol-5 4h-one, 2-phenyl-4h-oxazol-5-one, 2-oxazolin-5-one, 2-phenyl |
| PubChem CID | 65073 |
| ChEBI | CHEBI:60296 |
| IUPAC Name | 2-phenyl-4H-1,3-oxazol-5-one |
| SMILES | C1C(=O)OC(=N1)C2=CC=CC=C2 |
| Catalog Number | Mfr. No. | Quantity | Price | Quantity | |||||
|---|---|---|---|---|---|---|---|---|---|
| Catalog Number | Mfr. No. | Quantity | Price | Quantity | |||||
|
AAL0019403
|
Thermo Scientific Chemicals
L0019403 |
1 g |
Each for $124.92
|
|
|||||
|
AAL0019406
|
Thermo Scientific Chemicals
L0019406 |
5 g |
Each for $361.51
|
|
|||||
|
AAL0019414
|
Thermo Scientific Chemicals
L0019414 |
25 g |
Each for $1,412.04
|
|
|||||
Description
2-Phenyl-5-oxazolone is a reagent used as a masked glycine equivalent and for the formation of heterocyclic structures, it can be used to produce 4-benzylidene-2-phenyl-4H-oxazol-5-one.
This Thermo Scientific Chemicals brand product was originally part of the Alfa Aesar product portfolio. Some documentation and label information may refer to the legacy brand. The original Alfa Aesar product / item code or SKU reference has not changed as a part of the brand transition to Thermo Scientific Chemicals.
Applications2-Phenyl-5-oxazolone is a reagent used as a masked glycine equivalent and for the formation of heterocyclic structures, it can be used to produce 4-benzylidene-2-phenyl-4H-oxazol-5-one.
Solubility
Soluble in most common organic solvents.
Notes
Air Sensitive. Protect from heat. Store away from oxidizing agents.
Chemical Identifiers
| 1199-01-5 | |
| 161.16 | |
| QKCKCXFWENOGER-UHFFFAOYSA-N | |
| 65073 | |
| 2-phenyl-4H-1,3-oxazol-5-one |
| C9H7NO2 | |
| MFCD00014517 | |
| 2-phenyloxazol-5 4h-one, phenyloxazolone, 2-phenyl-5-oxazolone, 2-phenyloxazolone, 2-phenyloxazolin-5-one, 5 4h-oxazolone, 2-phenyl, 2-phenyl-5 4h-oxazolone, 2-phenyl-1,3-oxazol-5 4h-one, 2-phenyl-4h-oxazol-5-one, 2-oxazolin-5-one, 2-phenyl | |
| CHEBI:60296 | |
| C1C(=O)OC(=N1)C2=CC=CC=C2 |
Specifications
| 1199-01-5 | |
| C9H7NO2 | |
| 1 g | |
| Air sensitive | |
| Soluble in most common organic solvents. | |
| C1C(=O)OC(=N1)C2=CC=CC=C2 | |
| 161.16 | |
| CHEBI:60296 | |
| 97% |
| 89°C to 92°C | |
| MFCD00014517 | |
| 128465 | |
| 2-phenyloxazol-5 4h-one, phenyloxazolone, 2-phenyl-5-oxazolone, 2-phenyloxazolone, 2-phenyloxazolin-5-one, 5 4h-oxazolone, 2-phenyl, 2-phenyl-5 4h-oxazolone, 2-phenyl-1,3-oxazol-5 4h-one, 2-phenyl-4h-oxazol-5-one, 2-oxazolin-5-one, 2-phenyl | |
| QKCKCXFWENOGER-UHFFFAOYSA-N | |
| 2-phenyl-4H-1,3-oxazol-5-one | |
| 65073 | |
| 161.16 | |
| 2-Phenyl-5-oxazolone |
Safety and Handling
EINECSNumber : 214-840-2
TSCA : Yes
Recommended Storage : Keep cold
RUO – Research Use Only