Learn More
2-Nitrophenylhydrazine, 97%, moistened with ca 30% water
CAS: 3034-19-3 | C6H7N3O2 | 153.14 g/mol
Supplier: Thermo Scientific Chemicals 128830100
Description
This Thermo Scientific Chemicals brand product was originally part of the Acros Organics product portfolio. Some documentation and label information may refer to the legacy brand. The original Acros Organics product / item code or SKU reference has not changed as a part of the brand transition to Thermo Scientific Chemicals.
Specifications
| 2-Nitrophenylhydrazine | |
| 3034-19-3,7732-18-5 | |
| 100.0 | |
| Orange to Red | |
| Authentic | |
| Glass bottle | |
| O2NC6H4NHNH2 | |
| 10 g | |
| Solubility in water: miscible. Other solubilities: soluble in benzene | |
| C1=CC=C(C(=C1)NN)[N+](=O)[O-] | |
| 153.14 | |
| 153.14 | |
| Powder |
| 97% | |
| 96.0 | |
| 89.0°C to 94.0°C | |
| 30% to 35% | |
| 96% min. (HPLC) | |
| C6H7N3O2 | |
| MFCD00007577 | |
| 2-nitrophenyl hydrazine, hydrazine, nitrophenyl, hydrazine, o-nitrophenyl, o-nitrophenylhydrazine, hydrazine, 2-nitrophenyl, 2-nitrophenylhrdrazine, 2-nitrophenyl diazane, pubchem12859, acmc-1agti, o-nitrophenyl hydrazine | |
| FRBUNLLUASHNDJ-UHFFFAOYSA-N | |
| (2-nitrophenyl)hydrazine | |
| 3314739 | |
| 97% |
Chemical Identifiers
| 3034-19-3 | |
| 153.14 | |
| FRBUNLLUASHNDJ-UHFFFAOYSA-N | |
| 3314739 | |
| C1=CC=C(C(=C1)NN)[N+](=O)[O-] |
| C6H7N3O2 | |
| MFCD00007577 | |
| 2-nitrophenyl hydrazine, hydrazine, nitrophenyl, hydrazine, o-nitrophenyl, o-nitrophenylhydrazine, hydrazine, 2-nitrophenyl, 2-nitrophenylhrdrazine, 2-nitrophenyl diazane, pubchem12859, acmc-1agti, o-nitrophenyl hydrazine | |
| (2-nitrophenyl)hydrazine |
Safety and Handling
GHS H Statement
May cause respiratory irritation.
Causes skin irritation.
Causes serious eye irritation.
Harmful if swallowed.
GHS P Statement
Avoid breathing dust/fume/gas/mist/vapors/spray.
IF SWALLOWED: Call a POISON CENTER or doctor/physician if you feel unwell.
IF ON SKIN: Wash with plenty of soap and water.
Wear protective gloves/protective clothing/e
GHS Signal Word: Warning
EINECSNumber : 221-222-6
RUO – Research Use Only