missing translation for 'onlineSavingsMsg'
Learn More
Learn More
2-Nitrophenyl n-Octyl Ether 98.0+%, TCI America™
Supplier: TCI America S038010G
Specifications
| 2-Nitrophenyl n-Octyl Ether [Matrix for FABMS and liquid SIMS] | |
| 198°C | |
| MFCD00014693 | |
| 2-nitrophenyl octyl ether, 1-nitro-2-octyloxy benzene, octyl o-nitrophenyl ether, 2-nitrophenyl n-octyl ether, 2-octyloxy nitrobenzene, benzene, 1-nitro-2-octyloxy, 1-2-nitrophenoxy octane, 1-nitro-2-octyloxybenzene, 2-n-octyloxy nitrobenzene, npoe | |
| CCCCCCCCOC1=CC=CC=C1[N+](=O)[O-] | |
| 251.326 | |
| 251.33 | |
| Liquid |
| 37682-29-4 | |
| C14H21NO3 | |
| 10 g | |
| CXVOIIMJZFREMM-UHFFFAOYSA-N | |
| 1-nitro-2-octoxybenzene | |
| 169952 | |
| ≥98.0% (GC) |
Chemical Identifiers
| 37682-29-4 | |
| 251.326 | |
| CXVOIIMJZFREMM-UHFFFAOYSA-N | |
| 169952 | |
| CCCCCCCCOC1=CC=CC=C1[N+](=O)[O-] |
| C14H21NO3 | |
| MFCD00014693 | |
| 2-nitrophenyl octyl ether, 1-nitro-2-octyloxy benzene, octyl o-nitrophenyl ether, 2-nitrophenyl n-octyl ether, 2-octyloxy nitrobenzene, benzene, 1-nitro-2-octyloxy, 1-2-nitrophenoxy octane, 1-nitro-2-octyloxybenzene, 2-n-octyloxy nitrobenzene, npoe | |
| 1-nitro-2-octoxybenzene |
Safety and Handling
TSCA : Yes