Learn More
2-Nitroanisole, 99%
CAS: 91-23-6 | C7H7NO3 | 153.14 g/mol
$247.14 - $820.86
Chemical Identifiers
| CAS | 91-23-6 |
|---|---|
| Molecular Formula | C7H7NO3 |
| Molecular Weight (g/mol) | 153.14 |
| MDL Number | MFCD00007096 |
| InChI Key | CFBYEGUGFPZCNF-UHFFFAOYSA-N |
| Synonym | 2-nitroanisole, o-nitroanisole, anisole, o-nitro, 1-nitro-2-methoxybenzene, 2-methoxynitrobenzene, o-nitrophenyl methyl ether, benzene, 1-methoxy-2-nitro, 2-methoxy-1-nitrobenzene, benzene, methoxynitro, o-nitro methoxy benzene |
| PubChem CID | 7048 |
| ChEBI | CHEBI:48722 |
| IUPAC Name | 1-methoxy-2-nitrobenzene |
| SMILES | COC1=CC=CC=C1[N+]([O-])=O |
| Catalog Number | Mfr. No. | Quantity | Price | Quantity | |||||
|---|---|---|---|---|---|---|---|---|---|
| Catalog Number | Mfr. No. | Quantity | Price | Quantity | |||||
|
AAA1951836
|
Thermo Scientific Chemicals
A1951836 |
500 g |
Each for $247.14
|
|
|||||
|
AAA195180E
|
Thermo Scientific Chemicals
A195180E |
2500 g |
Each for $820.86
|
|
|||||
Description
This Thermo Scientific Chemicals brand product was originally part of the Alfa Aesar product portfolio. Some documentation and label information may refer to the legacy brand. The original Alfa Aesar product / item code or SKU reference has not changed as a part of the brand transition to Thermo Scientific Chemicals.
Chemical Identifiers
| 91-23-6 | |
| 153.14 | |
| CFBYEGUGFPZCNF-UHFFFAOYSA-N | |
| 7048 | |
| 1-methoxy-2-nitrobenzene |
| C7H7NO3 | |
| MFCD00007096 | |
| 2-nitroanisole, o-nitroanisole, anisole, o-nitro, 1-nitro-2-methoxybenzene, 2-methoxynitrobenzene, o-nitrophenyl methyl ether, benzene, 1-methoxy-2-nitro, 2-methoxy-1-nitrobenzene, benzene, methoxynitro, o-nitro methoxy benzene | |
| CHEBI:48722 | |
| COC1=CC=CC=C1[N+]([O-])=O |
Specifications
| 91-23-6 | |
| 1.254 | |
| 142°C (287°F) | |
| 1.561 | |
| 500 g | |
| 1868032 | |
| 2-nitroanisole, o-nitroanisole, anisole, o-nitro, 1-nitro-2-methoxybenzene, 2-methoxynitrobenzene, o-nitrophenyl methyl ether, benzene, 1-methoxy-2-nitro, 2-methoxy-1-nitrobenzene, benzene, methoxynitro, o-nitro methoxy benzene | |
| COC1=CC=CC=C1[N+]([O-])=O | |
| 153.14 | |
| CHEBI:48722 | |
| 99% |
| 9°C to 10°C | |
| 272°C to 273°C | |
| C7H7NO3 | |
| MFCD00007096 | |
| UN2730 | |
| 14,6585 | |
| CFBYEGUGFPZCNF-UHFFFAOYSA-N | |
| 1-methoxy-2-nitrobenzene | |
| 7048 | |
| 153.14 | |
| 2-Nitroanisole |
Safety and Handling
GHS H Statement
H350-H302
May cause cancer.
Harmful if swallowed.
P201-P202-P264b-P270-P281-P301+P312-P308+P313-P330-P501c
H302-H350
DOTInformation : Transport Hazard Class: 6.1; Packing Group: III; Proper Shipping Name: NITROANISOLE, LIQUID
EINECSNumber : 202-052-1
RTECSNumber : BZ8790000
TSCA : Yes
Recommended Storage : Ambient temperatures
RUO – Research Use Only