Learn More
1,8-Diaminooctane, 98%, Thermo Scientific™
Supplier: Thermo Scientific Chemicals 112315000
Description
This Thermo Scientific brand product was originally part of the Acros Organics product portfolio. Some documentation and label information may refer to the legacy brand. The original Acros Organics product / item code or SKU reference has not changed as a part of the brand transition to Thermo Scientific.
Specifications
| 1, 8-Diaminooctane | |
| 97.5 | |
| 165g/mL | |
| 115°C | |
| 97.5% min. (GC) | |
| C8H22Cl2N2 | |
| MFCD00008248 | |
| 04, 271 | |
| Solubility in water: 575g/L (20°C). | |
| [Cl-].[Cl-].[NH3+]CCCCCCCC[NH3+] | |
| 217.18 | |
| CHEBI:73112 | |
| 98% |
| 373-44-4 | |
| 100.0 | |
| 225.0°C to 226.0°C | |
| Authentic | |
| Glass bottle | |
| H2N(CH2)8NH2 | |
| 500g | |
| 1,8-diaminooctane, 1,8-octanediamine, octamethylenediamine, 1,8-octylenediamine, 1,8-octamethylenediamine, diaminooctane, octane 1,8-diamine, unii-53a6694pie, alpha,omega-diaminooctane, chembl29392 | |
| ZFLWZOGXFQNIMT-UHFFFAOYSA-N | |
| octane-1,8-diamine | |
| 24250 | |
| 144.26 |
Safety and Handling
GHS H Statement
Harmful if swallowed.
Causes severe skin burns and eye damage.
May cause an allergic skin reaction.
GHS P Statement
IF SWALLOWED: Rinse mouth.
Do NOT induce vomiting.
IF ON SKIN (or hair): Take off immediately all contaminated clothing.
Rinse skin with water/shower.
Immediately call a POISON CENTER or doctor/physician.
Wear
GHS Signal Word: Danger
EINECSNumber : 206-764-3
RUO â Research Use Only