Learn More
1,4-Dinitrobenzene, 98%
CAS: 100-25-4 | C6H4N2O4 | 168.11 g/mol
Supplier: Thermo Scientific Chemicals 408650250
Description
This Thermo Scientific Chemicals brand product was originally part of the Acros Organics product portfolio. Some documentation and label information may refer to the legacy brand. The original Acros Organics product / item code or SKU reference has not changed as a part of the brand transition to Thermo Scientific Chemicals.
Specifications
| 1, 4-Dinitrobenzene | |
| 97.5 | |
| 173°C to 175°C | |
| 1.6300g/mL | |
| 150°C | |
| 97.5% min. (GC) | |
| C6H4N2O4 | |
| MFCD00007314 | |
| 05, 261 | |
| 15, 3299 | |
| Solubility in water: 0.8g/L (20°C). Other solubilities: soluble in ethanol,ether,benzene,chloroform,,ethyl acetate,acetone and toluene | |
| C1=CC(=CC=C1[N+](=O)[O-])[N+](=O)[O-] | |
| 168.11 | |
| CHEBI:51398 | |
| 98% |
| 100-25-4 | |
| 100.0 | |
| Ochre to Orange | |
| 299°C | |
| Authentic | |
| Glass bottle | |
| NO2C6H4NO2 | |
| 25 g | |
| 1.63 | |
| p-dinitrobenzene, benzene, 1,4-dinitro, benzene, p-dinitro, dithane a-4, dinitrobenzene, p, dinitrobenzene, para, ccris 3092, 1,4-dinitro-benzene, 1,4-dinitrobenzene, analytical standard, para-dinitrobenzene | |
| FYFDQJRXFWGIBS-UHFFFAOYSA-N | |
| 1,4-dinitrobenzene | |
| 7492 | |
| 168.11 | |
| Crystals or Powder |
Chemical Identifiers
| 100-25-4 | |
| 168.11 | |
| FYFDQJRXFWGIBS-UHFFFAOYSA-N | |
| 7492 | |
| 1,4-dinitrobenzene |
| C6H4N2O4 | |
| MFCD00007314 | |
| p-dinitrobenzene, benzene, 1,4-dinitro, benzene, p-dinitro, dithane a-4, dinitrobenzene, p, dinitrobenzene, para, ccris 3092, 1,4-dinitro-benzene, 1,4-dinitrobenzene, analytical standard, para-dinitrobenzene | |
| CHEBI:51398 | |
| C1=CC(=CC=C1[N+](=O)[O-])[N+](=O)[O-] |
Safety and Handling
GHS H Statement
May cause damage to organs through prolonged or repeated exposure.
Very toxic to aquatic life with long lasting effects.
Fatal if inhaled.
Fatal in contact with skin.
GHS P Statement
Do not breathe dust/fume/gas/mist/vapors/spray.
Wear protective gloves/protective clothing/eye protection/face protection.
IF ON SKIN: Gently wash with plenty of soap and water.
Immediately call a POISON CENTER or do
GHS Signal Word: Danger
EINECSNumber : 202-833-7
RTECSNumber : CZ7525000
TSCA : TSCA
RUO – Research Use Only