Learn More
1,4-Dinitrobenzene, 98%
CAS: 100-25-4 | C6H4N2O4 | 168.11 g/mol
$106.50 - $410.17
Chemical Identifiers
| CAS | 100-25-4 |
|---|---|
| Molecular Formula | C6H4N2O4 |
| Molecular Weight (g/mol) | 168.11 |
| MDL Number | MFCD00007314 |
| InChI Key | FYFDQJRXFWGIBS-UHFFFAOYSA-N |
| Synonym | p-dinitrobenzene, benzene, 1,4-dinitro, benzene, p-dinitro, dithane a-4, dinitrobenzene, p, dinitrobenzene, para, ccris 3092, 1,4-dinitro-benzene, 1,4-dinitrobenzene, analytical standard, para-dinitrobenzene |
| PubChem CID | 7492 |
| ChEBI | CHEBI:51398 |
| IUPAC Name | 1,4-dinitrobenzene |
| SMILES | C1=CC(=CC=C1[N+](=O)[O-])[N+](=O)[O-] |
| Catalog Number | Mfr. No. | Quantity | Packaging | Price | Quantity | ||||
|---|---|---|---|---|---|---|---|---|---|
| Catalog Number | Mfr. No. | Quantity | Packaging | Price | Quantity | ||||
|
AC408650050
|
Thermo Scientific Chemicals
408650050 |
5 g | Glass bottle |
Each for $106.50
|
|
||||
|
AC408650250
|
Thermo Scientific Chemicals
408650250 |
25 g | Glass bottle |
Each for $410.17
|
|
||||
Description
This Thermo Scientific Chemicals brand product was originally part of the Acros Organics product portfolio. Some documentation and label information may refer to the legacy brand. The original Acros Organics product / item code or SKU reference has not changed as a part of the brand transition to Thermo Scientific Chemicals.
Chemical Identifiers
| 100-25-4 | |
| 168.11 | |
| FYFDQJRXFWGIBS-UHFFFAOYSA-N | |
| 7492 | |
| 1,4-dinitrobenzene |
| C6H4N2O4 | |
| MFCD00007314 | |
| p-dinitrobenzene, benzene, 1,4-dinitro, benzene, p-dinitro, dithane a-4, dinitrobenzene, p, dinitrobenzene, para, ccris 3092, 1,4-dinitro-benzene, 1,4-dinitrobenzene, analytical standard, para-dinitrobenzene | |
| CHEBI:51398 | |
| C1=CC(=CC=C1[N+](=O)[O-])[N+](=O)[O-] |
Specifications
| 100-25-4 | |
| 100.0 | |
| Ochre to Orange | |
| 299°C | |
| Authentic | |
| Glass bottle | |
| NO2C6H4NO2 | |
| 5 g | |
| 1.63 | |
| p-dinitrobenzene, benzene, 1,4-dinitro, benzene, p-dinitro, dithane a-4, dinitrobenzene, p, dinitrobenzene, para, ccris 3092, 1,4-dinitro-benzene, 1,4-dinitrobenzene, analytical standard, para-dinitrobenzene | |
| FYFDQJRXFWGIBS-UHFFFAOYSA-N | |
| 1,4-dinitrobenzene | |
| 7492 | |
| 168.11 | |
| Crystals or Powder |
| 97.5 | |
| 173°C to 175°C | |
| 1.6300g/mL | |
| 150°C | |
| 97.5% min. (GC) | |
| C6H4N2O4 | |
| MFCD00007314 | |
| 05, 261 | |
| 15, 3299 | |
| Solubility in water: 0.8g/L (20°C). Other solubilities: soluble in ethanol,ether,benzene,chloroform,,ethyl acetate,acetone and toluene | |
| C1=CC(=CC=C1[N+](=O)[O-])[N+](=O)[O-] | |
| 168.11 | |
| CHEBI:51398 | |
| 98% | |
| 1, 4-Dinitrobenzene |
Safety and Handling
GHS H Statement
May cause damage to organs through prolonged or repeated exposure.
Very toxic to aquatic life with long lasting effects.
Fatal if inhaled.
Fatal in contact with skin.
GHS P Statement
Do not breathe dust/fume/gas/mist/vapors/spray.
Wear protective gloves/protective clothing/eye protection/face protection.
IF ON SKIN: Gently wash with plenty of soap and water.
Immediately call a POISON CENTER or do
GHS Signal Word: Danger
EINECSNumber : 202-833-7
RTECSNumber : CZ7525000
TSCA : TSCA
RUO – Research Use Only