missing translation for 'onlineSavingsMsg'
Learn More
Learn More
1,2-Bis(diphenylphosphino)benzene, 98%, Thermo Scientific™
Supplier: Thermo Scientific Chemicals 363750010
Description
This Thermo Scientific brand product was originally part of the Acros Organics product portfolio. Some documentation and label information may refer to the legacy brand. The original Acros Organics product / item code or SKU reference has not changed as a part of the brand transition to Thermo Scientific.
Specifications
| 1, 2-Bis(diphenylphosphino)benzene | |
| 97.5 | |
| Authentic | |
| Glass bottle | |
| MFCD00014081 | |
| 1,2-bis diphenylphosphino benzene, dppbz, dppbe, dppben, dppbenz, o-bis diphenylphosphino benzene, 1,2-bis dimethylphosphino benzene, o-phenylenebis diphenylphosphine, phosphine, phenylenebis diphenyl, 1,2-bis diphenylphosphanyl benzene | |
| NFRYVRNCDXULEX-UHFFFAOYSA-N | |
| (2-diphenylphosphanylphenyl)-diphenylphosphane | |
| 498379 | |
| 98% |
| 13991-08-7 | |
| 100.0 | |
| 97.5% min | |
| C30H24P2 | |
| 1g | |
| Solubility in water: insoluble in water | |
| C1=CC=C(C=C1)P(C2=CC=CC=C2)C3=CC=CC=C3P(C4=CC=CC=C4)C5=CC=CC=C5 | |
| 446.47 | |
| 446.47 |
Chemical Identifiers
| 13991-08-7 | |
| 446.47 | |
| NFRYVRNCDXULEX-UHFFFAOYSA-N | |
| 498379 | |
| C1=CC=C(C=C1)P(C2=CC=CC=C2)C3=CC=CC=C3P(C4=CC=CC=C4)C5=CC=CC=C5 |
| C30H24P2 | |
| MFCD00014081 | |
| 1,2-bis diphenylphosphino benzene, dppbz, dppbe, dppben, dppbenz, o-bis diphenylphosphino benzene, 1,2-bis dimethylphosphino benzene, o-phenylenebis diphenylphosphine, phosphine, phenylenebis diphenyl, 1,2-bis diphenylphosphanyl benzene | |
| (2-diphenylphosphanylphenyl)-diphenylphosphane |
RUO â Research Use Only