Benzophenones
- (36)
- (2)
- (17)
- (45)
- (3)
- (1)
- (1)
- (2)
- (3)
- (5)
- (8)
- (6)
- (13)
- (10)
- (8)
- (5)
- (2)
- (1)
- (2)
- (6)
- (2)
- (2)
- (7)
- (3)
- (2)
- (4)
- (205)
- (2)
- (3)
- (3)
- (2)
- (1)
- (5)
- (3)
- (1)
- (3)
- (1)
- (2)
- (2)
- (2)
Résultats de la recherche filtrée
(2-Amino-5-nitrophenyl)(2-chlorophenyl)methanone, British Pharmacopoeia (BP) Reference Standard, MilliporeSigma™ Supelco™
This product is provided as delivered and specified by the issuing Pharmacopoeia. All information provided in support of this product, including SDS and any product information leaflets, has been developed and issued under the Authority of the issuing Pharmacopoeia.
TraceCERT™ 4,4'-Difluorobenzophenone, Certified Reference Material, MilliporeSigma™ Supelco™
This certified reference material (CRM) is produced and certified in accordance with ISO/IEC 17025 and ISO 17034. This CRM is traceable to the SI through a primary reference material from a NMI. Certified content incl. uncertainty and expiry date are stated on the enclosed certificate.
4-Methoxybenzophenone, 97%
CAS: 611-94-9 Formule moléculaire: C14H12O2 Poids moléculaire (g/mol): 212.25 Numéro MDL: MFCD00008403 Clé InChI: SWFHGTMLYIBPPA-UHFFFAOYSA-N Synonyme: 4-methoxybenzophenone,4-methoxyphenyl phenyl methanone,p-methoxybenzophenone,benzophenone, 4-methoxy,methanone, 4-methoxyphenyl phenyl,phenyl p-anisyl ketone,4-benzoylanisole,4-methoxyphenyl phenylmethanone,unii-i4xj07373m,4-methoxyphenyl-phenylmethanone CID PubChem: 69146 Nom IUPAC: (4-methoxyphenyl)-phenylmethanone SMILES: COC1=CC=C(C=C1)C(=O)C2=CC=CC=C2
| Poids moléculaire (g/mol) | 212.25 |
|---|---|
| Synonyme | 4-methoxybenzophenone,4-methoxyphenyl phenyl methanone,p-methoxybenzophenone,benzophenone, 4-methoxy,methanone, 4-methoxyphenyl phenyl,phenyl p-anisyl ketone,4-benzoylanisole,4-methoxyphenyl phenylmethanone,unii-i4xj07373m,4-methoxyphenyl-phenylmethanone |
| Numéro MDL | MFCD00008403 |
| CAS | 611-94-9 |
| CID PubChem | 69146 |
| Nom IUPAC | (4-methoxyphenyl)-phenylmethanone |
| Clé InChI | SWFHGTMLYIBPPA-UHFFFAOYSA-N |
| SMILES | COC1=CC=C(C=C1)C(=O)C2=CC=CC=C2 |
| Formule moléculaire | C14H12O2 |
4-Methylbenzophenone, 97%
CAS: 134-84-9 Formule moléculaire: C14H12O Poids moléculaire (g/mol): 196.25 Numéro MDL: MFCD00008553 Clé InChI: WXPWZZHELZEVPO-UHFFFAOYSA-N Synonyme: 4-methylbenzophenone,phenyl p-tolyl methanone,4-methylphenyl phenyl methanone,p-methylbenzophenone,methanone, 4-methylphenyl phenyl,p-benzoyltoluene,4-methyl benzophenone,phenyl p-tolyl ketone,benzophenone, 4-methyl,p-benzophenone, methyl CID PubChem: 8652 Nom IUPAC: (4-methylphenyl)-phenylmethanone SMILES: CC1=CC=C(C=C1)C(=O)C2=CC=CC=C2
| Poids moléculaire (g/mol) | 196.25 |
|---|---|
| Synonyme | 4-methylbenzophenone,phenyl p-tolyl methanone,4-methylphenyl phenyl methanone,p-methylbenzophenone,methanone, 4-methylphenyl phenyl,p-benzoyltoluene,4-methyl benzophenone,phenyl p-tolyl ketone,benzophenone, 4-methyl,p-benzophenone, methyl |
| Numéro MDL | MFCD00008553 |
| CAS | 134-84-9 |
| CID PubChem | 8652 |
| Nom IUPAC | (4-methylphenyl)-phenylmethanone |
| Clé InChI | WXPWZZHELZEVPO-UHFFFAOYSA-N |
| SMILES | CC1=CC=C(C=C1)C(=O)C2=CC=CC=C2 |
| Formule moléculaire | C14H12O |
2-Hydroxybenzophenone, 99%
CAS: 117-99-7 Formule moléculaire: C13H10O2 Poids moléculaire (g/mol): 198.22 Numéro MDL: MFCD00002216 Clé InChI: HJIAMFHSAAEUKR-UHFFFAOYSA-N Synonyme: 2-hydroxybenzophenone,o-benzoylphenol,2-hydroxyphenyl phenyl methanone,o-hydroxybenzophenone,benzophenone, 2-hydroxy,methanone, 2-hydroxyphenyl phenyl,phenyl 2-hydroxyphenyl ketone,unii-lqv22w4v05,ortho-hydroxybenzophenone,2-hydroxyphenyl phenylmethanone CID PubChem: 8348 Nom IUPAC: (2-hydroxyphenyl)-phenylmethanone SMILES: C1=CC=C(C=C1)C(=O)C2=CC=CC=C2O
| Poids moléculaire (g/mol) | 198.22 |
|---|---|
| Synonyme | 2-hydroxybenzophenone,o-benzoylphenol,2-hydroxyphenyl phenyl methanone,o-hydroxybenzophenone,benzophenone, 2-hydroxy,methanone, 2-hydroxyphenyl phenyl,phenyl 2-hydroxyphenyl ketone,unii-lqv22w4v05,ortho-hydroxybenzophenone,2-hydroxyphenyl phenylmethanone |
| Numéro MDL | MFCD00002216 |
| CAS | 117-99-7 |
| CID PubChem | 8348 |
| Nom IUPAC | (2-hydroxyphenyl)-phenylmethanone |
| Clé InChI | HJIAMFHSAAEUKR-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)C(=O)C2=CC=CC=C2O |
| Formule moléculaire | C13H10O2 |
Flubendazole, 98%
CAS: 31430-15-6 Formule moléculaire: C16H12FN3O3 Poids moléculaire (g/mol): 313.28 Clé InChI: CPEUVMUXAHMANV-UHFFFAOYSA-N Synonyme: flubendazole,flumoxane,flubendazol,fluvermal,flubenol,flubendazolum,flumoxal,flutelmium,methyl 5-4-fluorobenzoyl-1h-benzo d imidazol-2-yl carbamate,flubendazol inn-spanish CID PubChem: 35802 ChEBI: CHEBI:77095 Nom IUPAC: methyl N-[6-(4-fluorobenzoyl)-1H-benzimidazol-2-yl]carbamate SMILES: COC(=O)NC1=NC2=C(N1)C=C(C=C2)C(=O)C3=CC=C(C=C3)F
| Poids moléculaire (g/mol) | 313.28 |
|---|---|
| Synonyme | flubendazole,flumoxane,flubendazol,fluvermal,flubenol,flubendazolum,flumoxal,flutelmium,methyl 5-4-fluorobenzoyl-1h-benzo d imidazol-2-yl carbamate,flubendazol inn-spanish |
| CAS | 31430-15-6 |
| CID PubChem | 35802 |
| ChEBI | CHEBI:77095 |
| Nom IUPAC | methyl N-[6-(4-fluorobenzoyl)-1H-benzimidazol-2-yl]carbamate |
| Clé InChI | CPEUVMUXAHMANV-UHFFFAOYSA-N |
| SMILES | COC(=O)NC1=NC2=C(N1)C=C(C=C2)C(=O)C3=CC=C(C=C3)F |
| Formule moléculaire | C16H12FN3O3 |
4,4'-Difluorobenzophenone, 99%
CAS: 345-92-6 Formule moléculaire: C13H8F2O Poids moléculaire (g/mol): 218.20 Numéro MDL: MFCD00000353 Clé InChI: LSQARZALBDFYQZ-UHFFFAOYSA-N Synonyme: 4,4'-difluorobenzophenone,bis 4-fluorophenyl methanone,bis 4-fluorophenyl-methanone,methanone, bis 4-fluorophenyl,p,p'-difluorobenzophenone,di-p-fluorophenyl ketone,bis p-fluorophenyl ketone,bis 4-fluorophenyl ketone,benzophenone, 4,4'-difluoro,unii-88bnc11b9c CID PubChem: 9582 Nom IUPAC: bis(4-fluorophenyl)methanone SMILES: FC1=CC=C(C=C1)C(=O)C1=CC=C(F)C=C1
| Poids moléculaire (g/mol) | 218.20 |
|---|---|
| Synonyme | 4,4'-difluorobenzophenone,bis 4-fluorophenyl methanone,bis 4-fluorophenyl-methanone,methanone, bis 4-fluorophenyl,p,p'-difluorobenzophenone,di-p-fluorophenyl ketone,bis p-fluorophenyl ketone,bis 4-fluorophenyl ketone,benzophenone, 4,4'-difluoro,unii-88bnc11b9c |
| Numéro MDL | MFCD00000353 |
| CAS | 345-92-6 |
| CID PubChem | 9582 |
| Nom IUPAC | bis(4-fluorophenyl)methanone |
| Clé InChI | LSQARZALBDFYQZ-UHFFFAOYSA-N |
| SMILES | FC1=CC=C(C=C1)C(=O)C1=CC=C(F)C=C1 |
| Formule moléculaire | C13H8F2O |
4,4'-Dimethylbenzophenone, 98+%
CAS: 611-97-2 Formule moléculaire: C15H14O Poids moléculaire (g/mol): 210.28 Numéro MDL: MFCD00017214 Clé InChI: ZWPWLKXZYNXATK-UHFFFAOYSA-N Synonyme: 4,4'-dimethylbenzophenone,p-tolyl ketone,bis 4-methylphenyl methanone,di-p-tolyl ketone,methanone, bis 4-methylphenyl,p,p'-dimethylbenzophenone,p,p'-dimethyl di-phenyl ketone,bis-p-tolylmethanone,benzophenone, 4,4'-dimethyl,4,4-dimethylbenzophenone CID PubChem: 69148 Nom IUPAC: bis(4-methylphenyl)methanone SMILES: CC1=CC=C(C=C1)C(=O)C2=CC=C(C=C2)C
| Poids moléculaire (g/mol) | 210.28 |
|---|---|
| Synonyme | 4,4'-dimethylbenzophenone,p-tolyl ketone,bis 4-methylphenyl methanone,di-p-tolyl ketone,methanone, bis 4-methylphenyl,p,p'-dimethylbenzophenone,p,p'-dimethyl di-phenyl ketone,bis-p-tolylmethanone,benzophenone, 4,4'-dimethyl,4,4-dimethylbenzophenone |
| Numéro MDL | MFCD00017214 |
| CAS | 611-97-2 |
| CID PubChem | 69148 |
| Nom IUPAC | bis(4-methylphenyl)methanone |
| Clé InChI | ZWPWLKXZYNXATK-UHFFFAOYSA-N |
| SMILES | CC1=CC=C(C=C1)C(=O)C2=CC=C(C=C2)C |
| Formule moléculaire | C15H14O |
4,4'-Dihydroxybenzophenone, 97%
CAS: 611-99-4 Formule moléculaire: C13H10O3 Poids moléculaire (g/mol): 214.22 Numéro MDL: MFCD00002358 Clé InChI: RXNYJUSEXLAVNQ-UHFFFAOYSA-N Synonyme: 4,4'-dihydroxybenzophenone,bis 4-hydroxyphenyl methanone,hbp ketone,methanone, bis 4-hydroxyphenyl,bis 4-hydroxyphenyl ketone,4,4'-dihydoxy-benzophenone,bis p-hydroxy benzophenone,p,p'-dihydroxybenzophenone,4,4'-dihydroxydiphenyl ketone,benzophenone, 4,4'-dihydroxy CID PubChem: 69150 ChEBI: CHEBI:34365 Nom IUPAC: bis(4-hydroxyphenyl)methanone SMILES: C1=CC(=CC=C1C(=O)C2=CC=C(C=C2)O)O
| Poids moléculaire (g/mol) | 214.22 |
|---|---|
| Synonyme | 4,4'-dihydroxybenzophenone,bis 4-hydroxyphenyl methanone,hbp ketone,methanone, bis 4-hydroxyphenyl,bis 4-hydroxyphenyl ketone,4,4'-dihydoxy-benzophenone,bis p-hydroxy benzophenone,p,p'-dihydroxybenzophenone,4,4'-dihydroxydiphenyl ketone,benzophenone, 4,4'-dihydroxy |
| Numéro MDL | MFCD00002358 |
| CAS | 611-99-4 |
| CID PubChem | 69150 |
| ChEBI | CHEBI:34365 |
| Nom IUPAC | bis(4-hydroxyphenyl)methanone |
| Clé InChI | RXNYJUSEXLAVNQ-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1C(=O)C2=CC=C(C=C2)O)O |
| Formule moléculaire | C13H10O3 |
4-Hydroxybenzophenone, 98+%
CAS: 1137-42-4 Formule moléculaire: C13H10O2 Poids moléculaire (g/mol): 198.22 Numéro MDL: MFCD00002355 Clé InChI: NPFYZDNDJHZQKY-UHFFFAOYSA-N Synonyme: 4-hydroxybenzophenone,4-benzoylphenol,4-hydroxyphenyl phenyl methanone,p-benzoylphenol,p-hydroxybenzophenone,methanone, 4-hydroxyphenyl phenyl,4-hydroxyphenyl phenylmethanone,benzophenone, 4-hydroxy,unii-04r2lws0ms,4'-hydroxybenzophenone CID PubChem: 14347 ChEBI: CHEBI:34421 Nom IUPAC: (4-hydroxyphenyl)-phenylmethanone SMILES: OC1=CC=C(C=C1)C(=O)C1=CC=CC=C1
| Poids moléculaire (g/mol) | 198.22 |
|---|---|
| Synonyme | 4-hydroxybenzophenone,4-benzoylphenol,4-hydroxyphenyl phenyl methanone,p-benzoylphenol,p-hydroxybenzophenone,methanone, 4-hydroxyphenyl phenyl,4-hydroxyphenyl phenylmethanone,benzophenone, 4-hydroxy,unii-04r2lws0ms,4'-hydroxybenzophenone |
| Numéro MDL | MFCD00002355 |
| CAS | 1137-42-4 |
| CID PubChem | 14347 |
| ChEBI | CHEBI:34421 |
| Nom IUPAC | (4-hydroxyphenyl)-phenylmethanone |
| Clé InChI | NPFYZDNDJHZQKY-UHFFFAOYSA-N |
| SMILES | OC1=CC=C(C=C1)C(=O)C1=CC=CC=C1 |
| Formule moléculaire | C13H10O2 |
2-Aminobenzophenone, 98%
CAS: 2835-77-0 Formule moléculaire: C13H11NO Poids moléculaire (g/mol): 197.24 Numéro MDL: MFCD00007713 Clé InChI: MAOBFOXLCJIFLV-UHFFFAOYSA-N Synonyme: 2-aminobenzophenone,2-benzoylaniline,o-benzoylaniline,o-aminobenzophenone,2-aminophenyl phenyl methanone,methanone, 2-aminophenyl phenyl,benzophenone, 2-amino,2-amino-phenyl-phenyl-methanone,2-aminophenyl phenyl ketone,methanone, aminophenyl phenyl CID PubChem: 76080 Nom IUPAC: (2-aminophenyl)-phenylmethanone SMILES: NC1=CC=CC=C1C(=O)C1=CC=CC=C1
| Poids moléculaire (g/mol) | 197.24 |
|---|---|
| Synonyme | 2-aminobenzophenone,2-benzoylaniline,o-benzoylaniline,o-aminobenzophenone,2-aminophenyl phenyl methanone,methanone, 2-aminophenyl phenyl,benzophenone, 2-amino,2-amino-phenyl-phenyl-methanone,2-aminophenyl phenyl ketone,methanone, aminophenyl phenyl |
| Numéro MDL | MFCD00007713 |
| CAS | 2835-77-0 |
| CID PubChem | 76080 |
| Nom IUPAC | (2-aminophenyl)-phenylmethanone |
| Clé InChI | MAOBFOXLCJIFLV-UHFFFAOYSA-N |
| SMILES | NC1=CC=CC=C1C(=O)C1=CC=CC=C1 |
| Formule moléculaire | C13H11NO |
2-Amino-5-chlorobenzophenone, 98%
CAS: 719-59-5 Formule moléculaire: C13H10ClNO Poids moléculaire (g/mol): 231.68 Numéro MDL: MFCD00007839 Clé InChI: ZUWXHHBROGLWNH-UHFFFAOYSA-N Synonyme: 2-amino-5-chlorobenzophenone,2-amino-5-chlorophenyl phenyl methanone,2-benzoyl-4-chloroaniline,methanone, 2-amino-5-chlorophenyl phenyl,2-amino-5-chlorbenzophenone,5-chloro-2-aminobenzophenone,2-amino-5-chlorobenzylphenone,benzophenone, 2-amino-5-chloro,unii-fr80014zbt,2-amino-5-chlorophenyl phenylmethanone CID PubChem: 12870 Nom IUPAC: (2-amino-5-chlorophenyl)-phenylmethanone SMILES: NC1=CC=C(Cl)C=C1C(=O)C1=CC=CC=C1
| Poids moléculaire (g/mol) | 231.68 |
|---|---|
| Synonyme | 2-amino-5-chlorobenzophenone,2-amino-5-chlorophenyl phenyl methanone,2-benzoyl-4-chloroaniline,methanone, 2-amino-5-chlorophenyl phenyl,2-amino-5-chlorbenzophenone,5-chloro-2-aminobenzophenone,2-amino-5-chlorobenzylphenone,benzophenone, 2-amino-5-chloro,unii-fr80014zbt,2-amino-5-chlorophenyl phenylmethanone |
| Numéro MDL | MFCD00007839 |
| CAS | 719-59-5 |
| CID PubChem | 12870 |
| Nom IUPAC | (2-amino-5-chlorophenyl)-phenylmethanone |
| Clé InChI | ZUWXHHBROGLWNH-UHFFFAOYSA-N |
| SMILES | NC1=CC=C(Cl)C=C1C(=O)C1=CC=CC=C1 |
| Formule moléculaire | C13H10ClNO |
4-Bromobenzophenone, 97%
CAS: 90-90-4 Formule moléculaire: C13H9BrO Poids moléculaire (g/mol): 261.12 Numéro MDL: MFCD00000103 Clé InChI: KEOLYBMGRQYQTN-UHFFFAOYSA-N Synonyme: 4-bromobenzophenone,4-bromophenyl phenyl methanone,p-bromobenzophenone,methanone, 4-bromophenyl phenyl,benzophenone, 4-bromo,p-benzoylbromobenzene,usaf do-3,4-bromophenyl phenyl ketone,4-bromophenyl-phenyl-methanone,4-bromophenyl-phenylmethanone CID PubChem: 7030 Nom IUPAC: (4-bromophenyl)-phenylmethanone SMILES: BrC1=CC=C(C=C1)C(=O)C1=CC=CC=C1
| Poids moléculaire (g/mol) | 261.12 |
|---|---|
| Synonyme | 4-bromobenzophenone,4-bromophenyl phenyl methanone,p-bromobenzophenone,methanone, 4-bromophenyl phenyl,benzophenone, 4-bromo,p-benzoylbromobenzene,usaf do-3,4-bromophenyl phenyl ketone,4-bromophenyl-phenyl-methanone,4-bromophenyl-phenylmethanone |
| Numéro MDL | MFCD00000103 |
| CAS | 90-90-4 |
| CID PubChem | 7030 |
| Nom IUPAC | (4-bromophenyl)-phenylmethanone |
| Clé InChI | KEOLYBMGRQYQTN-UHFFFAOYSA-N |
| SMILES | BrC1=CC=C(C=C1)C(=O)C1=CC=CC=C1 |
| Formule moléculaire | C13H9BrO |
4,4'-Dimethoxybenzophenone, 97%
CAS: 90-96-0 Formule moléculaire: C15H14O3 Poids moléculaire (g/mol): 242.27 Numéro MDL: MFCD00008404 Clé InChI: RFVHVYKVRGKLNK-UHFFFAOYSA-N Synonyme: 4,4'-dimethoxybenzophenone,bis 4-methoxyphenyl methanone,methanone, bis 4-methoxyphenyl,p,p'-dimethoxybenzophenone,dmbp,bis p-anisyl ketone,bis 4-anisyl ketone,bis p-methoxy benzophenone,benzophenone, 4,4'-dimethoxy,1,1-di p-methoxyphenyl-ketone CID PubChem: 7032 Nom IUPAC: bis(4-methoxyphenyl)methanone SMILES: COC1=CC=C(C=C1)C(=O)C1=CC=C(OC)C=C1
| Poids moléculaire (g/mol) | 242.27 |
|---|---|
| Synonyme | 4,4'-dimethoxybenzophenone,bis 4-methoxyphenyl methanone,methanone, bis 4-methoxyphenyl,p,p'-dimethoxybenzophenone,dmbp,bis p-anisyl ketone,bis 4-anisyl ketone,bis p-methoxy benzophenone,benzophenone, 4,4'-dimethoxy,1,1-di p-methoxyphenyl-ketone |
| Numéro MDL | MFCD00008404 |
| CAS | 90-96-0 |
| CID PubChem | 7032 |
| Nom IUPAC | bis(4-methoxyphenyl)methanone |
| Clé InChI | RFVHVYKVRGKLNK-UHFFFAOYSA-N |
| SMILES | COC1=CC=C(C=C1)C(=O)C1=CC=C(OC)C=C1 |
| Formule moléculaire | C15H14O3 |